| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 2-Bromoethylbenzene
-
- $50.00
-
2025-06-20
- CAS:1973-22-4
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10000
- 2-Bromoethylbenzene
-
- $2.00
-
2019-07-06
- CAS:1973-22-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 2-Bromoethylbenzene Basic information |
| | 2-Bromoethylbenzene Chemical Properties |
| Melting point | -56 °C | | Boiling point | 199 °C(lit.) | | density | 1.338 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.549(lit.) | | Fp | 171 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Specific Gravity | 1.35 | | BRN | 1929735 | | Henry's Law Constant | 3.0×10-3 mol/(m3Pa) at 25℃, Hine and Mookerjee (1975) | | InChI | InChI=1S/C8H9Br/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3 | | InChIKey | HVRUGFJYCAFAAN-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC=C1CC | | CAS DataBase Reference | 1973-22-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-bromo-2-ethyl-(1973-22-4) |
| Hazard Codes | Xi,N,O | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-61-24/25 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | F | 9 | | HazardClass | IRRITANT | | HS Code | 29036990 | | Storage Class | 10 - Combustible liquids |
| | 2-Bromoethylbenzene Usage And Synthesis |
| Chemical Properties | Clear colourless to light yellow liquid | | Uses | 1-Bromo-2-ethylbenzene may be used in the synthesis of:
- 1-(2′-ethylphenyl)ethanol
- N-benzyl-P-(2-ethylphenyl)-P-phenylphosphinic amide
- 4-(isopropyldimethylsilyl)-2-(2-ethylphenyl)pyridine
- 5-amino-2′-ethyl -biphenyl-2-ol, used for modification of carbon paste electrode
| | General Description | 1-Bromo-2-ethylbenzene is an organobromine compound. |
| | 2-Bromoethylbenzene Preparation Products And Raw materials |
|