| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:α-D-GlucosaMine 1-Phosphate CAS:2152-75-2 Package:100Mg,10Mg
|
| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:α-D-GlucosaMine 1-Phosphate ;2-AMino-2-deoxy-α-D-glucopyranose 1-(dihydrogen phosphate); 2-AMino-2-deoxy-α-D-glucopyranosyl Phosphate CAS:2152-75-2 Purity:98+% Package:1Mg;5Mg;10Mg;50Mg;100Mg;500Mg
|
|
| | ALPHA-D-GLUCOSAMINE 1-PHOSPHATE Basic information |
| Product Name: | ALPHA-D-GLUCOSAMINE 1-PHOSPHATE | | Synonyms: | ALPHA-D-GLUCOSAMINE 1-PHOSPHATE;A-D-glucosamine 1-phosphate free acid;α-d-glucosamine 1-phosphate;alpha-D-glucosamine phosphate;[(2R,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate;[(2R,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-methylol-tetrahydropyran-2-yl] dihydrogen phosphate;[(2R,3R,4R,5S,6R)-3-azanyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate;2-AMino-2-deoxy-α-D-glucopyranose 1-(dihydrogen phosphate) | | CAS: | 2152-75-2 | | MF: | C6H14NO8P | | MW: | 259.15 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives;Intermediates & Fine Chemicals;Pharmaceuticals;Phosphorylating and Phosphitylating Agents;Carbohydrates;Carbohydrates A to;Carbohydrates GBiochemicals and Reagents;Monosaccharide | | Mol File: | 2152-75-2.mol |  |
| | ALPHA-D-GLUCOSAMINE 1-PHOSPHATE Chemical Properties |
| Melting point | >120°C (dec.) | | Boiling point | 596.0±60.0 °C(Predicted) | | density | 1.81±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Water (Sparingly), | | pka | 1.73±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | biological source | natural (inorganic) | | Water Solubility | water: 100mg/mL, clear, colorless | | Stability: | Hygroscopic | | InChI | 1S/C6H14NO8P/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13) | | InChIKey | YMJBYRVFGYXULK-UHFFFAOYSA-N | | SMILES | NC1C(O)C(O)C(CO)OC1OP(O)(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | ALPHA-D-GLUCOSAMINE 1-PHOSPHATE Usage And Synthesis |
| Uses | ALPHA-D-GLUCOSAMINE 1-PHOSPHATE is a phosphorylated glucosamine used in the enzymatic α-glucosaminylation of maltooligosaccharides catalyzed by phosphorylase. | | Uses | A phosphorylated glucosamine used in the enzymatic α-glucosaminylation of maltooligosaccharides catalyzed by phosphorylase. | | Definition | ChEBI: Alpha-D-glucosamine 1-phosphate is a glucosamine phosphate. It has a role as an Escherichia coli metabolite. It is functionally related to an alpha-D-glucosamine. It is a conjugate acid of an alpha-D-glucosamine 1-phosphate(1-). |
| | ALPHA-D-GLUCOSAMINE 1-PHOSPHATE Preparation Products And Raw materials |
|