| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(S)-(+)-N-3-Benzylnirvanol
CAS:790676-40-3
Package:50Mg,5Mg
|
(S)-(+)-N-3-Benzylnirvanol manufacturers
|
| | (S)-(+)-N-3-Benzylnirvanol Basic information |
| Product Name: | (S)-(+)-N-3-Benzylnirvanol | | Synonyms: | (S)-(+)-N-3-Benzylnirvanol;(5S)-5-ethyl-5-phenyl-3-(phenylmethyl)-2,4-imidazolidinedione, 5-ethyl-5-phenyl-3-(phenylmethyl)-hydantoin;(5S)-5-Ethyl-5-phenyl-3-(phenylmethyl)-2,4-imidazolidinedione;5-ethyl-5-phenyl-3-(phenylmethyl)-hydantoin;(S)-(+)-Benzylnirvanol;(+)-N-3-BENZYL NIRVANOL;(S)-3-Benzyl-5-ethyl-5-phenylimidazolidine-2,4-dione;2,4-Imidazolidinedione, 5-ethyl-5-phenyl-3-(phenylmethyl)-, (5S)- | | CAS: | 790676-40-3 | | MF: | C18H18N2O2 | | MW: | 294.35 | | EINECS: | | | Product Categories: | All Inhibitors;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 790676-40-3.mol |  |
| | (S)-(+)-N-3-Benzylnirvanol Chemical Properties |
| Melting point | 147-1500C | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >20mg/mL | | form | powder | | pka | 8.02±0.70(Predicted) | | color | Off-white to light yellow | | InChI | 1S/C18H18N2O2/c1-2-18(15-11-7-4-8-12-15)16(21)20(17(22)19-18)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,19,22)/t18-/m0/s1 | | InChIKey | ZMZDHUHMXXALFX-SFHVURJKSA-N | | SMILES | CC[C@]1(NC(=O)N(Cc2ccccc2)C1=O)c3ccccc3 |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-50 | | Safety Statements | 26-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Eye Irrit. 2 |
| | (S)-(+)-N-3-Benzylnirvanol Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | It is a potent and selective human CYP2C19 inhibitor | | Biochem/physiol Actions | (+)-N-3-Benzyl-nirvanol is a potent selective CYP2C19 inhibitor. CYP2C19 has a high frequency of drug resistance; highly polymorphic. | | IC 50 | CYP2C19: 250 nM (Ki) |
| | (S)-(+)-N-3-Benzylnirvanol Preparation Products And Raw materials |
|