|
|
| | AC-LYS-OME HCL Basic information |
| | AC-LYS-OME HCL Chemical Properties |
| Melting point | 108-114 °C(lit.) | | storage temp. | −20°C | | form | powder | | Optical Rotation | [α]22/D 18°, c = 10 in 6 M HCl | | Major Application | peptide synthesis | | InChI | InChI=1/C9H18N2O3.ClH/c1-7(12)11-8(9(13)14-2)5-3-4-6-10;/h8H,3-6,10H2,1-2H3,(H,11,12);1H/t8-;/s3 | | InChIKey | PCHGTXYLEAQWOM-JNODIIHCNA-N | | SMILES | [C@@H](CCCCN)(NC(=O)C)C(=O)OC.Cl |&1:0,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2924190090 | | Storage Class | 11 - Combustible Solids |
| | AC-LYS-OME HCL Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | Nα-Acetyl-L-lysine Methyl Ester Hydrochloride is used in the synthetic preparation of AB-type N-substituted core-functionalized naphthalene diimides. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | AC-LYS-OME HCL Preparation Products And Raw materials |
|