- apiosylskimmin
-
- $9.80
-
2020-01-10
- CAS:103529-94-8
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | apiosylskimmin Basic information |
| Product Name: | apiosylskimmin | | Synonyms: | apiosylskimmin;(-)-Adicardin;7-O-beta-D-Apiofuranosyl-(1-6)-beta-D-glucopyranosyl-umbelliferone;2H-1-Benzopyran-2-one,7-[(6-O-D-apio-b-D-furanosyl-b-D-glucopyranosyl)oxy]-;2H-1-Benzopyran-2-one, 7-[(6-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-;Adicardin >=95% (LC/MS-ELSD);Adicardin;Umbelliferone Impurity 26 (Apiosylskimmin) | | CAS: | 103529-94-8 | | MF: | C20H24O12 | | MW: | 456.4 | | EINECS: | | | Product Categories: | | | Mol File: | 103529-94-8.mol |  |
| | apiosylskimmin Chemical Properties |
| Melting point | 201-202℃ | | Boiling point | 804.4±65.0 °C(Predicted) | | density | 1.68 | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 12.71±0.70(Predicted) | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | SXPBJYHKMRWZNA-ZITSYKRSSA-N | | SMILES | OC[C@@]1(O)CO[C@@H](OC[C@H]2O[C@@H](Oc3ccc4C=CC(=O)Oc4c3)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | apiosylskimmin Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, from the roots of Angelica biserrata (Shan et Yuan) Yuan et Shan; Angelica dahurica (Fisch. ex Hoffm.) Benth. et Hook. f. ex. Franch. et Sav. | | Uses | Adicardin displays inhibitory activities on high concentration of potassium and dl-norepinephrine (NE)-induced contractions. Also, it is a compound with anti-chronic renal failure activity isolated from Hydrangea macrophylla. |
| | apiosylskimmin Preparation Products And Raw materials |
|