- Licarin B
-
- $33.00 / 1mg
-
2025-10-15
- CAS:51020-87-2
- Min. Order:
- Purity: 100.00%
- Supply Ability: 10g
- (-)-Licarin B
-
- $0.00 / 20mg
-
2023-02-24
- CAS:51020-87-2
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 100 g
- licarin B
-
- $1.00 / 1kg
-
2019-07-06
- CAS:51020-87-2
- Min. Order: 1 mg
- Purity: 99%
- Supply Ability: 100KG
|
| | licarin B Basic information |
| Product Name: | licarin B | | Synonyms: | 1,3-Benzodioxole,5-[(2R,3R)-2,3-dihydro-7-Methoxy-3-Methyl-5-(1E)-1-propenyl-2-benzofuranyl]-(9CI);licarin B;5-[(2S)-2,3-Dihydro-7-methoxy-3β-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-1,3-benzodioxole;5-((2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-(1E)-1-propenyl-2-benzofuranyl)-1,3-benzodioxole;5-[(3S)-7-methoxy-3-methyl-5-[(E)-prop-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]-1,3-benzodioxole;Licarine B;1,3-Benzodioxole, 5-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]-;(-)-Licarin B | | CAS: | 51020-87-2 | | MF: | C20H20O4 | | MW: | 324.37 | | EINECS: | 2017-001-1 | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;reagent;standard substance | | Mol File: | 51020-87-2.mol |  |
| | licarin B Chemical Properties |
| Boiling point | 428.5±45.0 °C(Predicted) | | density | 1.201±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | color | White | | InChI | InChI=1S/C20H20O4/c1-4-5-13-8-15-12(2)19(24-20(15)18(9-13)21-3)14-6-7-16-17(10-14)23-11-22-16/h4-10,12,19H,11H2,1-3H3/b5-4+/t12-,19-/m1/s1 | | InChIKey | DMMQXURQRMNSBM-YZAYTREXSA-N | | SMILES | O1C2=CC=C([C@H]3[C@H](C)C4=CC(/C=C/C)=CC(OC)=C4O3)C=C2OC1 |
| | licarin B Usage And Synthesis |
| Chemical Properties | White crystals, soluble in methanol, ethanol, DMSO and other organic solvents, derived from nutmeg, Lauraceae (Lauraceae) Licarin aritu Ducke trunk (yield: 0.35%) Machilus japonica Sieb.et Zucc. Ye Hongnan Machilus thunbergii Sieb.et Zucc. Bark, wood, leaves. | | Uses | Licarin B has antibacterial, anti-inflammatory, sedative and anti-tumor effects. | | Biological Activity | Licarin B, derived from the seeds of Myristica fragrans, is an inhibitor of NO production and improves insulin sensitivity by activating PPARγ and GLUT4 in the IRS-1/PI3K/AKT pathway. | | in vitro | Licarin B (5 μM, 10 μM, 15 μM. 8 days) moderately increases TG accumulation during adipogenic differentiation and showed partial PPARg agonist activity in 3T3-L1 preadipocytes. Cell Viability Assay < /p> | Cell Line: | 3T3-L1 cell. | | Concentration: | 1-500 μM. | | Incubation Time: | 48 h. | | Result: | Did not cause significant cell death up to 500 μM concentration. | Cell Viability Assay | Cell Line: | 3T3-L1 cell. | | Concentration: | 5 μM, 10 μM, 15 μM. | | Incubation Time: | 8 days (replaced every 2 days). | 8 days (replaced every 2 days). | td> | Result: | LB at 15 μM concentration significantly promoted adipocyte differentiation and caused intracellular TG accumulation. | < span class="view_more"> | | target | PPAR | GLUT | PI3K | Akt | IRS-1 |
| | licarin B Preparation Products And Raw materials |
|