|
|
| | 9-((S)-3-Hydroxy-2-(phosphonomethoxy)propyl)adenine Basic information |
| Product Name: | 9-((S)-3-Hydroxy-2-(phosphonomethoxy)propyl)adenine | | Synonyms: | 9-[(S)-3-Hydroxy-2-(phosphonomethoxy)propyl]adenine;(S)-9-(3-Hydroxy-2-phosphonomethoxypropyl)adenine;(S)-HPMPA;[[(1S)-1-(Hydroxymethyl)-2-(6-amino-9H-purine-9-yl)ethoxy]methyl]phosphonic acid;[[(S)-2-(6-Amino-9H-purin-9-yl)-1-(hydroxymethyl)ethoxy]methyl]phosphonic acid;9-[(S)-3-Hydroxy-2-(phosphonomethoxy)propyl]-9H-purine-6-amine;GS 0577;(S)-(((1-(6-Amino-9H-purin-9-yl)-3-hydroxypropan-2-yl)oxy)methyl)phosphonic acid | | CAS: | 92999-29-6 | | MF: | C9H14N5O5P | | MW: | 303.21 | | EINECS: | | | Product Categories: | | | Mol File: | 92999-29-6.mol |  |
| | 9-((S)-3-Hydroxy-2-(phosphonomethoxy)propyl)adenine Chemical Properties |
| Melting point | 255-257 °C | | Boiling point | 719.6±70.0 °C(Predicted) | | density | 1.91±0.1 g/cm3(Predicted) | | pka | 2.31±0.10(Predicted) | | InChI | InChI=1S/C9H14N5O5P/c10-8-7-9(12-3-11-8)14(4-13-7)1-6(2-15)19-5-20(16,17)18/h3-4,6,15H,1-2,5H2,(H2,10,11,12)(H2,16,17,18)/t6-/m0/s1 | | InChIKey | FRPXSOOHWNMLPH-LURJTMIESA-N | | SMILES | P(CO[C@H](CO)CN1C2C(N=C1)=C(N)N=CN=2)(=O)(O)O |
| | 9-((S)-3-Hydroxy-2-(phosphonomethoxy)propyl)adenine Usage And Synthesis |
| Description | 9-((S)-3-Hydroxy-2-(phosphonomethoxy)propyl)adenine [(S)-HPMPA] is a non-cyclic nucleotide analogue that acts as a potent and selective inhibitor of African swine fever virus (ASFV) replication. It has been reported that (S)-HPMPA exerts a specific, dose-dependent inhibitory effect on viral DNA synthesis. Furthermore, (S)-HPMPA also inhibits the production of late viral proteins (particularly IP-73) in ASFV-infected MS and Vero cells[1]. | | Preparation | 9-(S)-(3-Hydroxy-2-phosphonylmethoxypropyl)adenine (HPMPA) was prepared from 9-(S)-(2,3-dihydroxypropyl)adenine (DHPA) via its 3-O-chloromethanephosphonate[2]. | | References | [1] O. Arzuza . (1988). Inhibition of African swine fever virus DNA synthesis by (S)-9-(3-hydroxy-2-phosphonylmethoxypropyl)adenine. Biochemical and Biophysical Research Communications, 154 1, Pages 27-32. https://doi.org/10.1016/0006-291X(88)90644-4
[2] A Holý, I R. (1987). Stereospecific syntheses of 9-(S)-(3-hydroxy-2-phosphonylmethoxypropyl)adenine (HPMPA). Nucleic Acids Symposium Series, 18, 33–36.
|
| | 9-((S)-3-Hydroxy-2-(phosphonomethoxy)propyl)adenine Preparation Products And Raw materials |
|