- Androst-2-en-17-one
-
-
2026-08-18
- CAS:963-75-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000 KG
- Androst-2-en-17-one
-
-
2025-12-24
- CAS:963-75-7
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KG
|
| | Androst-2-en-17-one Basic information |
| Product Name: | Androst-2-en-17-one | | Synonyms: | OCCLESTERONE;16-[5ALPHA]ANDROSTEN-3-ONE;16,(5A)-ANDROSTEN-3-ONE;17-oxo-5a-androst-2-ene;5-Androst-16-en-3-one;5-a-anrosta-2-en-17-one;16,(5A)-ANDROSTEN-3-ONE, 98%MIN;(5S,8R,9S,10S,13S,14S)-10,13-Dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one | | CAS: | 963-75-7 | | MF: | C19H28O | | MW: | 272.43 | | EINECS: | 213-517-3 | | Product Categories: | Metabolites & Impurities;Steroids | | Mol File: | 963-75-7.mol |  |
| | Androst-2-en-17-one Chemical Properties |
| Melting point | 140-145 °C(lit.) | | Boiling point | 371.6±42.0 °C(Predicted) | | density | 1.032±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMF: 15 mg/ml,DMSO: insol,Ethanol: 10 mg/ml,PBS (pH 7.2): insol | | form | A solid | | InChI | InChI=1/C19H28O/c1-18-11-4-3-5-13(18)6-7-14-15-8-9-17(20)19(15,2)12-10-16(14)18/h3-4,13-16H,5-12H2,1-2H3/t13-,14+,15+,16+,18+,19+/s3 | | InChIKey | ISJVDMWNISUFRJ-LPDARYMINA-N | | SMILES | C[C@]12CC=CC[C@]1([H])CC[C@@]1([H])[C@]3([H])CCC(=O)[C@@]3(C)CC[C@]21[H] |&1:1,6,10,12,18,22,r| | | CAS DataBase Reference | 963-75-7(CAS DataBase Reference) | | NIST Chemistry Reference | Androst-2-en-17-one, (5«alpha»)-(963-75-7) |
| | Androst-2-en-17-one Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Metabolite of 5α-Androst-16-en-3β-ol |
| | Androst-2-en-17-one Preparation Products And Raw materials |
|