| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Naphthalene-1,2,3,4-13C4 Basic information |
| | Naphthalene-1,2,3,4-13C4 Chemical Properties |
| Melting point | 80-82 °C(lit.) | | Boiling point | 218 °C(lit.) | | Fp | 80 °C | | InChI | 1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1+1,2+1,5+1,6+1 | | InChIKey | UFWIBTONFRDIAS-MAUGHLKVSA-N | | SMILES | c1ccc2[13cH][13cH][13cH][13cH]c2c1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-40-50/53 | | Safety Statements | 36/37-46-60-61 | | RIDADR | UN 1334 4.1/PG 3 | | WGK Germany | WGK 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Flam. Sol. 2 |
| | Naphthalene-1,2,3,4-13C4 Usage And Synthesis |
| | Naphthalene-1,2,3,4-13C4 Preparation Products And Raw materials |
|