| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Coriamyrtin Basic information |
| Product Name: | Coriamyrtin | | Synonyms: | Coriamyrtin;(7S,8R)-1aβ,1b,5,6,6a,7aβ-Hexahydro-1bα-hydroxy-6aα-methyl-8-(1-methylethenyl)spiro[2α,5α-methano-7H-oxireno[3,4]cyclopent[1,2-d]oxepine-7,2'-oxiran]-3(2H)-one;Spiro[2,5-methano-7H-oxireno[3,4]cyclopent[1,2-d]oxepin-7,2'-oxiran]-3(2H)-one, hexahydro-1b-hydroxy-6a-methyl-8-(1-methylethenyl)-, (1aS,1bR,2S,2'R,5S,6aR,7aR,8R)-;Coriamyrtin USP/EP/BP;(1aS,1bR,2S,2′R,5S,6aR,7aR,8R)-Hexahydro-1b-hydroxy-6a-methyl-8-(1-methylethenyl)spiro[2,5-methano-7H-oxireno[3,4]cyclopent[1,2-d]oxepin-7,2′-oxiran]-3(2H)-one | | CAS: | 2571-86-0 | | MF: | C15H18O5 | | MW: | 278.3 | | EINECS: | | | Product Categories: | | | Mol File: | 2571-86-0.mol |  |
| | Coriamyrtin Chemical Properties |
| Melting point | 229-230° | | alpha | D14 +79° | | Boiling point | 341.12°C (rough estimate) | | density | 1.1384 (rough estimate) | | refractive index | 1.6200 (estimate) | | InChI | InChI=1S/C15H18O5/c1-6(2)8-7-4-13(3)14(5-18-14)10-11(20-10)15(13,17)9(8)12(16)19-7/h7-11,17H,1,4-5H2,2-3H3/t7-,8+,9+,10+,11-,13-,14+,15-/m0/s1 | | InChIKey | BWWDLKVKPVKBGJ-TWMZOSGRSA-N | | SMILES | O1C(=O)[C@@]2([H])[C@H](C(C)=C)[C@]1([H])C[C@@]1(C)[C@@]3(CO3)[C@]3([H])O[C@]3([H])[C@]12O |
| Toxicity | LD50 i.p. in mice: 3 mg/kg (Jarboe) |
| | Coriamyrtin Usage And Synthesis |
| | Coriamyrtin Preparation Products And Raw materials |
|