4-Hydroxypyridine-3-carboxaldehyde manufacturers
|
| Product Name: | 4-Hydroxypyridine-3-carboxaldehyde | | Synonyms: | 4-Hydroxypyridine-3-carboxaldehyde;4-hydroxy-3-Pyridinecarboxaldehyde;4-Hydroxynicotinaldehyde;4-Hydroxy-pyridine-3-carbaldehyde;4-OXO-1H-PYRIDINE-3-CARBALDEHYDE;3-Pyridinecarboxaldehyde, 4-hydroxy-;4-Hydroxypyridine-3-carboxaldehyde ISO 9001：2015 REACH;4-hydroxypyridine-3-formaldehyde | | CAS: | 89380-70-1 | | MF: | C6H5NO2 | | MW: | 123.11 | | EINECS: | | | Product Categories: | | | Mol File: | 89380-70-1.mol |  |
| | 4-Hydroxypyridine-3-carboxaldehyde Chemical Properties |
| Boiling point | 371.3±22.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.45±0.18(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C6H5NO2/c8-4-5-3-7-2-1-6(5)9/h1-4H,(H,7,9) | | InChIKey | IYPSYYLXHFGFPC-UHFFFAOYSA-N | | SMILES | C1=NC=CC(O)=C1C=O |
| | 4-Hydroxypyridine-3-carboxaldehyde Usage And Synthesis |
| Uses | 4-Hydroxy-3-pyridinecarboxaldehyde contains a hydroxyl unit and exhibits enol tautomerism. It is mainly used as an organic synthesis intermediate and can be used to prepare 3,4-bifunctionalized pyridine derivatives. | | Application | The basic and nucleophilic properties of 4-hydroxy-3-pyridinecarboxaldehyde in chemical reactions make it an important intermediate in organic synthesis. Under specific reaction conditions, its basic nitrogen atom and nucleophilic hydroxyl group can participate in different reactions to produce different derivatives of pyridine compounds. This versatility gives this compound broad application potential in the preparation of a variety of organic compounds. |
| | 4-Hydroxypyridine-3-carboxaldehyde Preparation Products And Raw materials |
|