| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- BOC-N-ME-SER-OH
-
- $1.00
-
2019-07-12
- CAS:101772-29-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 25kg
|
| | Boc-N-Me-Ser-OH Basic information |
| Product Name: | Boc-N-Me-Ser-OH | | Synonyms: | BOC-MESER-OH;BOC-N-ME-SERINE;BOC-L-MESER-OH;N-ALPHA-(T-BUTYLOXYCARBONYL)-N-ALPHA-METHYL-L-SERINE;N-ALPHA-T-BUTOXYCARBONYL-N-ALPHA-METHYL-L-SERINE;BOC-N-.ALPHA.-METHYL-L-SERINE;(S)-2-((tert-butoxycarbonyl)(Methyl)aMino)-3-hydroxypropanoic acid;N-Boc-N-Methyl-L-serine, 98% | | CAS: | 101772-29-6 | | MF: | C9H17NO5 | | MW: | 219.24 | | EINECS: | 1533716-785-6 | | Product Categories: | amino acids;N-Methyl Amino Acids | | Mol File: | 101772-29-6.mol |  |
| | Boc-N-Me-Ser-OH Chemical Properties |
| Melting point | 83-87 °C | | Boiling point | 353.2±42.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.63±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D 33±2°, c = 1% in methanol | | BRN | 8685334 | | Major Application | peptide synthesis | | InChI | InChI=1S/C9H17NO5/c1-9(2,3)15-8(14)10(4)6(5-11)7(12)13/h6,11H,5H2,1-4H3,(H,12,13)/t6-/m0/s1 | | InChIKey | NJQGIDVCNBZXLG-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CO)N(C(OC(C)(C)C)=O)C |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-N-Me-Ser-OH Usage And Synthesis |
| Description | Boc-N-Me-Ser-OH is a serine derivative, it is used in peptide synthesis. | | Chemical Properties | White to off-white solid | | Uses | N-Boc-N-methyl-L-serine is used as a precursor in organic synthesis and pharmaceuticals. | | Uses | Boc-N-Me-Ser-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. |
| | Boc-N-Me-Ser-OH Preparation Products And Raw materials |
|