| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Disperse Black 9 CAS:20721-50-0 Purity:Dye content 97 % Package:5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Disperse Black 9 CAS:20721-50-0 Purity:Dye content 97 % Package:5G Remarks:456691-5G
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:Disperse black 9 CAS:20721-50-0 Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
Shaanxi Dideu Newmaterial Co., Ltd.
|
| Tel: |
029-63373950 17392216152 |
| Email: |
1050@dideu.com |
| Products Intro: |
Product Name:2,2'-[[4-[(4-aminophenyl)azo]phenyl]imino]bisethanol CAS:20721-50-0 Purity:98% Package:25KG
|
|
| | DISPERSE BLACK 9 Basic information |
| Product Name: | DISPERSE BLACK 9 | | Synonyms: | Ethanol, 2,2-4-(4-aminophenyl)azophenyliminobis-;2,2’-[[4-[(4-aminophenyl)azo]phenyl]imino]bis-ethano;2,2'-[[4-[(4-aminophenyl)azo]phenyl]imino]bisethanol;2,2'-((p-((p-Aminophenyl)azo)phenyl)imino)diethanol;Einecs 243-987-5;Ethanol, 2,2'-((4-(2-(4-aminophenyl)diazenyl)phenyl)imino)bis-;DISPERSE BLACK 9 ISO 9001:2015 REACH | | CAS: | 20721-50-0 | | MF: | C16H20N4O2 | | MW: | 300.36 | | EINECS: | 243-987-5 | | Product Categories: | Organics;dye | | Mol File: | 20721-50-0.mol |  |
| | DISPERSE BLACK 9 Chemical Properties |
| Melting point | 157-160 °C(lit.) | | Boiling point | 569.2±50.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | room temp | | pka | 14.21±0.10(Predicted) | | form | powder | | λmax | 461 nm | | ε(extinction coefficient) | ≥20000 at 458-464nm in H2O | | Major Application | diagnostic assay manufacturing hematology histology | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | 1S/C16H20N4O2/c17-13-1-3-14(4-2-13)18-19-15-5-7-16(8-6-15)20(9-11-21)10-12-22/h1-8,21-22H,9-12,17H2 | | InChIKey | NZKTVPCPQIEVQT-UHFFFAOYSA-N | | SMILES | Nc1ccc(cc1)N=Nc2ccc(cc2)N(CCO)CCO | | LogP | 2.500 (est) | | EPA Substance Registry System | Ethanol, 2,2'-[[4-[(4-aminophenyl)azo]phenyl]imino]bis- (20721-50-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DISPERSE BLACK 9 Usage And Synthesis |
| Uses | diagnostic assay manufacturing hematology histology |
| | DISPERSE BLACK 9 Preparation Products And Raw materials |
|