Bromochlorophenol Blue manufacturers
|
| | Bromochlorophenol Blue Basic information |
| | Bromochlorophenol Blue Chemical Properties |
| Melting point | 230 °C | | Boiling point | 602.9±55.0 °C(Predicted) | | density | 1.962±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | Solubility Sparingly soluble in water; soluble in ethanol | | pka | 6.05(at 25℃) | | form | powder | | color | Violet-pink | | PH Range | 3(yellow)-4.6(blue/violet) | | Water Solubility | sparingly soluble | | λmax | 590nm | | ε(extinction coefficient) | ≥15000 at 306-310nm in 0.1 M NaOH at 0.01g/L
≥8000 at 378-382nm in 0.1 M NaOH at 0.01g/L | | BRN | 365559 | | Major Application | Display device, pH sensors, inks, photoreceptors, lithographic plates, materials, determination of surfactants, lubricants, food shelf life, in protein assays, vaginal infection test, detecting proteins | | InChI | 1S/C19H10Br2Cl2O5S/c20-12-5-9(7-14(22)17(12)24)19(10-6-13(21)18(25)15(23)8-10)11-3-1-2-4-16(11)29(26,27)28-19/h1-8,24-25H | | InChIKey | MDGFKZKMIQQRPU-UHFFFAOYSA-N | | SMILES | Oc1c(Cl)cc(cc1Br)C2(OS(=O)(=O)c3ccccc23)c4cc(Cl)c(O)c(Br)c4 | | CAS DataBase Reference | 2553-71-1(CAS DataBase Reference) |
| | Bromochlorophenol Blue Usage And Synthesis |
| Chemical Properties | pink powder | | Uses | Bromochlorophenol Blue (CAS# 2553-71-1) is a pH indicator and has been used in colorimetric sensor arrays for detection and Identification of sugars. Dyes and metabolites. |
| | Bromochlorophenol Blue Preparation Products And Raw materials |
|