methyl 4-(methylamino)butanoate hydrochloride manufacturers
|
| | methyl 4-(methylamino)butanoate hydrochloride Basic information |
| Product Name: | methyl 4-(methylamino)butanoate hydrochloride | | Synonyms: | methyl 4-(methylamino)butanoate hydrochloride;Methyl 4-(methylamino)butyrate hydrochloride;Methyl N-Methyl-4-aminobutanoate hydrochloride;Methyl 4-(methylamino)butanoate HCl;Methyl 4-(methylamino)butanoate hydrochloride (1:1);Butanoic acid, 4-(methylamino)-, methyl ester, hydrochloride;Azelastine Impurity 9(Hydrochloride);Azelastine Impurity 9 HCl | | CAS: | 89584-24-7 | | MF: | C6H14ClNO2 | | MW: | 167.63386 | | EINECS: | | | Product Categories: | | | Mol File: | 89584-24-7.mol |  |
| | methyl 4-(methylamino)butanoate hydrochloride Chemical Properties |
| Melting point | 46-48℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H13NO2.ClH/c1-7-5-3-4-6(8)9-2;/h7H,3-5H2,1-2H3;1H | | InChIKey | YIONSXWIAKPSAL-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCNC.[H]Cl |
| | methyl 4-(methylamino)butanoate hydrochloride Usage And Synthesis |
| | methyl 4-(methylamino)butanoate hydrochloride Preparation Products And Raw materials |
|