|
|
| | 3-(4-Fluorophenyl)propionic acid Basic information |
| | 3-(4-Fluorophenyl)propionic acid Chemical Properties |
| Melting point | 86-91 °C (lit.) | | Boiling point | 105-107 °C(Press: 22 Torr) | | density | 1.222±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | slightly sol. in Methanol | | form | Crystalline Powder or Crystals | | pka | 4+-.0.10(Predicted) | | color | White to off-white | | BRN | 1869084 | | InChI | InChI=1S/C9H9FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12) | | InChIKey | ZMKXWDPUXLPHCA-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=C(F)C=C1 | | CAS DataBase Reference | 459-31-4(CAS DataBase Reference) | | NIST Chemistry Reference | 3-(4-Fluorophenyl)propionic acid(459-31-4) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37/38 | | Safety Statements | 45-36/37/39-26-37/39 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 13 - Non Combustible Solids |
| | 3-(4-Fluorophenyl)propionic acid Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder or crystals | | Uses | 3-(4-Fluorophenyl)propionic acid may be used in the synthesis of 2-oxopiperazine guanidine analog. |
| | 3-(4-Fluorophenyl)propionic acid Preparation Products And Raw materials |
|