|
|
| | 6-METHOXY-2-NAPHTHOIC ACID Basic information |
| | 6-METHOXY-2-NAPHTHOIC ACID Chemical Properties |
| Melting point | 201-206 °C (lit.) | | Boiling point | 371.1±17.0 °C(Predicted) | | density | 1.263±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly. Sonicated), Ethyl Acetate (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 4.30±0.30(Predicted) | | color | White to Pale Brown | | BRN | 2211233 | | InChI | InChI=1S/C12H10O3/c1-15-11-5-4-8-6-10(12(13)14)3-2-9(8)7-11/h2-7H,1H3,(H,13,14) | | InChIKey | YZBILXXOZFORFE-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(OC)C=C2)=CC=C1C(O)=O | | CAS DataBase Reference | 2471-70-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2918992090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 6-METHOXY-2-NAPHTHOIC ACID Usage And Synthesis |
| Chemical Properties | white powder | | Uses | An impurity of Naproxen (N377525) with bactericidal and fungicidal activity. A metabolite of Nabumetone (N200500). Naproxen USP Related Compound A. | | Definition | ChEBI: 6-Methoxy-2-naphthoic acid is a naphthoic acid. |
| | 6-METHOXY-2-NAPHTHOIC ACID Preparation Products And Raw materials |
|