|
|
| | 2-methoxycarbonylbenzylsulfonamide Basic information |
| | 2-methoxycarbonylbenzylsulfonamide Chemical Properties |
| Melting point | 100 °C | | Boiling point | 429.8±55.0 °C(Predicted) | | density | 1.361±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | pka | 10.15±0.60(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C9H11NO4S/c1-14-9(11)8-5-3-2-4-7(8)6-15(10,12)13/h2-5H,6H2,1H3,(H2,10,12,13) | | InChIKey | DBOUFTHAEAVMJC-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC=C1CS(N)(=O)=O | | CAS DataBase Reference | 112941-26-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-[(aminosulfonyl)methyl]-, methyl ester (112941-26-1) |
| Hazard Codes | Xi | | TSCA | TSCA listed | | HS Code | 2916399090 |
| | 2-methoxycarbonylbenzylsulfonamide Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | o-Carbomethoxybenzyl Sulfonamide is a useful reactant in organic synthesis. |
| | 2-methoxycarbonylbenzylsulfonamide Preparation Products And Raw materials |
|