| Company Name: |
pinkeyan Gold |
| Tel: |
4000-685-696 18932660197 |
| Email: |
pinkeyan@163.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Copper(II) ethylacetoacetate Basic information |
| Product Name: | Copper(II) ethylacetoacetate | | Synonyms: | COPPER ETHYLACETOACETATE;CUPRIC ETHYLACETOACETATE;ETHYL ACETOACETATE, COPPER DERIVATIVE;copper(II) ethylacetoacetate 97%;Acetoacetic acid, ethyl ester, copper complex;Bis(ethyl acetoacetato)copper;Bis(ethyl acetylacetate)copper(ii);Copper bis(ethyl acetylacetonate) | | CAS: | 14284-06-1 | | MF: | C12H18CuO6 | | MW: | 321.81 | | EINECS: | 238-181-5 | | Product Categories: | metal beta-diketonate complexes | | Mol File: | 14284-06-1.mol |  |
| | Copper(II) ethylacetoacetate Chemical Properties |
| Melting point | 192°C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | solubility | Soluble in ethanol | | form | Powder | | color | green to blue | | Water Solubility | soluble EtOH, chloroform [CRC10] | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Exposure limits | ACGIH: TWA 1 mg/m3
NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 | | InChI | 1S/2C6H10O3.Cu/c2*1-3-5(4(2)7)6(8)9;/h2*5H,3H2,1-2H3,(H,8,9);/q;;+2/p-2 | | InChIKey | BWRKZNDMFFOZJB-UHFFFAOYSA-L | | SMILES | CCC(C(C)=O)C(=O)O[Cu]OC(=O)C(CC)C(C)=O | | CAS DataBase Reference | 14284-06-1(CAS DataBase Reference) | | EPA Substance Registry System | Copper, bis[ethyl 3-(oxo-.kappa.O)butanoato-.kappa.O']- (14284-06-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | Copper(II) ethylacetoacetate Usage And Synthesis |
| Chemical Properties | Blue-green powder.
Insoluble in water; soluble in most organic solvents. | | Uses | Copper(II) ethylacetoacetate it acts as a common cu(+2) precursor. It is also used in chemical research. | | Uses | Fungicide, intermediate. | | reaction suitability | core: copper
reagent type: catalyst |
| | Copper(II) ethylacetoacetate Preparation Products And Raw materials |
|