| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Ethyl acetoacetate sodium salt Basic information |
| Product Name: | Ethyl acetoacetate sodium salt | | Synonyms: | Ethyl acetoacetate, sodium salt, balance mainly sodium acetate;Ethyl 2-oxobutanoate sodiuM salt;sodium:(E)-4-ethoxy-4-oxobut-2-en-2-olate;Cyclopentane-1,2-Dicarboximde;ETHYL ACETOACETATE, SODIUM SALT, TECH.,9 5%;ca85%,balancemainlysodiumacetate;Ethyl acetoacetate, sodium salt, balance mainly sodium acetate, ca. 85%;ETHYL ACETOACETATE, SODIUM SALT, CA 85%, BALANCE MAINLY SODIUM ACETATE | | CAS: | 20412-62-8 | | MF: | C7H9NO2 | | MW: | 139.15186 | | EINECS: | | | Product Categories: | Pharmaceutical Intermediates;Micro/Nanoelectronics;Solution Deposition Precursors | | Mol File: | 20412-62-8.mol |  |
| | Ethyl acetoacetate sodium salt Chemical Properties |
| Melting point | 168 °C (dec.)(lit.) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C6H10O3.Na/c1-3-9-6(8)4-5(2)7;/h4,7H,3H2,1-2H3;/q;+1/p-1/b5-4+; | | InChIKey | DCZNCNBYKPIZRQ-UHFFFAOYSA-M | | SMILES | [Na+].CCOC(=O)\C=C(/C)[O-] |
| WGK Germany | 1 | | Storage Class | 11 - Combustible Solids |
| | Ethyl acetoacetate sodium salt Usage And Synthesis |
| Chemical Properties | light yellow to beige powder | | Uses | Ethyl acetoacetate sodium salt can be used as: - A chelating agent or ligand precursor to form metal-organic frameworks (MOFs) and coordination polymers, which are important in catalysis, sensors, and energy storage materials.
- A stabilizer or precursor in solution-phase reactions to produce metal oxide nanoparticles, which serve as advanced electrode materials in batteries, supercapacitors, and fuel cells.
- A β-keto ester component in the synthesis of complex heterocyclic structures, which are of significant interest in medicinal chemistry.
| | reaction suitability | core: sodium |
| | Ethyl acetoacetate sodium salt Preparation Products And Raw materials |
|