|
|
| | Methanone, [4-(2-chloro-4-nitrophenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)- Basic information |
| Product Name: | Methanone, [4-(2-chloro-4-nitrophenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)- | | Synonyms: | Methanone, [4-(2-chloro-4-nitrophenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)-;Nucleozin;[4-(2-Chloro-4-nitro-phenyl)-piperazin-1-yl]-(5-methyl-3-phenyl-isoxazol-4-yl)-methanone;1-(2-Chloro-4-nitrophenyl)-4-[(5-methyl-3-phenyl-4-isoxazolyl)carbonyl]-piperazine;[4-(2-Chloro-4-nitrophenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)methanone;CS-681;Nucleozin >=98% (HPLC), powder;inhibit,Nucleozin,viral,Inhibitor,infection,Influenza Virus,nuclear,nucleoprotein,virus,replication,accumulation | | CAS: | 341001-38-5 | | MF: | C21H19ClN4O4 | | MW: | 426.85 | | EINECS: | | | Product Categories: | | | Mol File: | 341001-38-5.mol | - Structure](CAS/GIF/341001-38-5.gif) |
| | Methanone, [4-(2-chloro-4-nitrophenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)- Chemical Properties |
| density | 1.371 | | storage temp. | 2-8°C | | solubility | DMSO: >15mg/mL | | form | powder | | color | yellow | | InChI | 1S/C21H19ClN4O4/c1-14-19(20(23-30-14)15-5-3-2-4-6-15)21(27)25-11-9-24(10-12-25)18-8-7-16(26(28)29)13-17(18)22/h2-8,13H,9-12H2,1H3 | | InChIKey | OWXBJAPOSQSWAO-UHFFFAOYSA-N | | SMILES | Cc1onc(-c2ccccc2)c1C(=O)N3CCN(CC3)c4ccc(cc4Cl)[N+]([O-])=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methanone, [4-(2-chloro-4-nitrophenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)- Usage And Synthesis |
| Uses | Nucleozin may be used in anti-viral (anti-influenza) research to study its pharmacokinetics, metabolism, safety, efficacy and methods of delivery as an influenza A nucleoprotein (a multifunctional, RNA-binding protein necessary for virus replication) targeting drug candidate. | | Biological Activity | Nucleozin targets influenza A nucleoprotein (NP), a multifunctional, RNA-binding protein necessary for virus replication. Nucleozin is effective in fighting H1N1, H3N2, and H5N1 flu virus strains by inducing the formation of NP aggregates and antagonizing its nuclear accumulation, leading to cessation of viral replication.', 'Nucleozin targets influenza A nucleoprotein, a multifunctional, RNA-binding protein necessary for virus replication. It induces the formation of nucleoptotein aggregates and inhibits its accumulation, interfering with viral replication. EC50 is in the nM range. Nucleozin is effective in H1N1, H3N2, and H5N1 flu virus strains. | | in vivo | Nucleozin protectes mice challenged with lethal doses of avian influenza A H5N1[1]. | | target | Influenza Virus NP |
| | Methanone, [4-(2-chloro-4-nitrophenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)- Preparation Products And Raw materials |
|