H-GAMMA-GLU-ALA-OH manufacturers
- H-GAMMA-GLU-ALA-OH
-
- $7.00 / 1KG
-
2020-02-19
- CAS: 5875-41-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | H-GAMMA-GLU-ALA-OH Basic information |
| | H-GAMMA-GLU-ALA-OH Chemical Properties |
| Melting point | 188-192 °C (lit.) | | Boiling point | 564.4±50.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | Water:50.0(Max Conc. mg/mL);229.14(Max Conc. mM) | | pka | 2.22±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D 26.5°, c = 5 in H2O | | Major Application | peptide synthesis | | InChI | 1S/C8H14N2O5/c1-4(7(12)13)10-6(11)3-2-5(9)8(14)15/h4-5H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1 | | InChIKey | WQXXXVRAFAKQJM-WHFBIAKZSA-N | | SMILES | C[C@H](NC(=O)CC[C@H](N)C(O)=O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-GAMMA-GLU-ALA-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | H-GAMMA-GLU-ALA-OH is a proteolytic breakdown product of larger proteins that is suitable for peptide synthesis. It is also used in a biological study that looked at kokumi substances and bacteria in fermented Thai freshwater fish. | | Definition | ChEBI: A gamma-glutamylalanine obtained by formal condensation of the gamma-carboxy group of L-glutamic acid with the amino group of L-alanine. | | reaction suitability | reaction type: solution phase peptide synthesis | | IC 50 | Human Endogenous Metabolite |
| | H-GAMMA-GLU-ALA-OH Preparation Products And Raw materials |
|