| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- FMOC-L-HOMOLEUCINE
-
- $1.00
-
2020-01-10
- CAS:180414-94-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | Fmoc-L-homoleucine Basic information |
| Product Name: | Fmoc-L-homoleucine | | Synonyms: | L-alpha-(Fmoc-amino)-delta-methylhexa;(S)-2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-5-methylhexanoic acid;Fmoc-L-Homoleucine-OH;FMoc-(S)-2-aMino-5-Methylhexanoic acid;FMOC-L-HOL;FMOC-L-HOLEU-OH;RARECHEM EM WB 0130;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-L-HOMOLEUCINE | | CAS: | 180414-94-2 | | MF: | C22H25NO4 | | MW: | 367.44 | | EINECS: | | | Product Categories: | unnatural amino acids;amino acids | | Mol File: | 180414-94-2.mol |  |
| | Fmoc-L-homoleucine Chemical Properties |
| Boiling point | 568.1±33.0 °C(Predicted) | | density | 1.188±0.06 g/cm3(Predicted) | | storage temp. | Store below +30°C. | | form | Solid | | pka | 3.91±0.23(Predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C22H25NO4/c1-14(2)11-12-20(21(24)25)23-22(26)27-13-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,14,19-20H,11-13H2,1-2H3,(H,23,26)(H,24,25)/t20-/m0/s1 | | InChIKey | UJOQOPBFLFQOJJ-FQEVSTJZSA-N | | SMILES | N([C@@H](CCC(C)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 2 water endangering | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-homoleucine Usage And Synthesis |
| Chemical Properties | White solid | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-homoleucine Preparation Products And Raw materials |
|