Fmoc-hocha-OH manufacturers
- FMOC-HOCHA-OH
-
- $7.00
-
2019-12-20
- CAS:269078-73-1
- Min. Order: 1KG
- Purity: 99%
|
| | Fmoc-hocha-OH Basic information |
| Product Name: | Fmoc-hocha-OH | | Synonyms: | Cyclohexanebutanoicacid, a-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-,(aS)-;(2S)-4-cyclohexyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid;Fmoc-L-homocyclohexylalanine;Fmoc-homocyclohexyl-alanine;FMOC-HOMOCYCLOHEXYL-L-ALANINE;FMOC-L-HOMOCHA;RARECHEM EM WB 0128;Fmoc-homocyclohexyl-L-alanine≥ 99% (HPLC) | | CAS: | 269078-73-1 | | MF: | C25H29NO4 | | MW: | 407.5 | | EINECS: | | | Product Categories: | | | Mol File: | 269078-73-1.mol |  |
| | Fmoc-hocha-OH Chemical Properties |
| Boiling point | 618.1±38.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.93±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChIKey | KYXCSTPOLMVGMS-CRPMJUFNNA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CCC2CCCCC2)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| HazardClass | IRRITANT | | HS Code | 29225090 |
| | Fmoc-hocha-OH Usage And Synthesis |
| Chemical Properties | White powder |
| | Fmoc-hocha-OH Preparation Products And Raw materials |
|