| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Fluoro-5-(trifluoromethyl)phenyl isocyanate Basic information |
| | 2-Fluoro-5-(trifluoromethyl)phenyl isocyanate Chemical Properties |
| Boiling point | 53 °C2.5 mm Hg(lit.) | | density | 1.418 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | 159 °F | | form | Liquid | | color | Clear colorless | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C8H3F4NO/c9-6-2-1-5(8(10,11)12)3-7(6)13-4-14/h1-3H | | InChIKey | NAIKHCBDZGSGHH-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(C(F)(F)F)C=C1N=C=O | | CAS DataBase Reference | 69922-27-6(CAS DataBase Reference) |
| Hazard Codes | Xn,C,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 2922 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lacrymatory | | HazardClass | TOXIC, LACHRYMATOR | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29291090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 2-Fluoro-5-(trifluoromethyl)phenyl isocyanate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Useful pharmaceutical building block for the preparation of ureas from amines. | | General Description | 2-Fluoro-5-(trifluoromethyl)phenyl isocyanate is a fluorinated building block. |
| | 2-Fluoro-5-(trifluoromethyl)phenyl isocyanate Preparation Products And Raw materials |
|