6-ACRYLAMIDOHEXANOIC ACID manufacturers
|
| | 6-ACRYLAMIDOHEXANOIC ACID Basic information | | Uses |
| Product Name: | 6-ACRYLAMIDOHEXANOIC ACID | | Synonyms: | Nsc288649;6-[(1-oxo-2-propen-1-yl)amino]Hexanoic acid;6-(ACRYLOYLAMINO)HEXANOIC ACID;6-ACRYLAMIDOHEXANOIC ACID;6-Acrylamidohexanoic Acid >;Hexanoic acid, 6-[(1-oxo-2-propen-1-yl)amino]-;6-(prop-2-enoylamino)hexanoicaci;6-(prop-2-enoylamino)hexanoic acid | | CAS: | 20766-85-2 | | MF: | C9H15NO3 | | MW: | 185.22 | | EINECS: | 618-347-7 | | Product Categories: | | | Mol File: | 20766-85-2.mol |  |
| | 6-ACRYLAMIDOHEXANOIC ACID Chemical Properties |
| Melting point | 89 °C | | Boiling point | 417.5±37.0 °C(Predicted) | | density | 1.072±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.75±0.10(Predicted) | | color | White to Almost white | | Stability: | Light Sensitive | | InChI | InChI=1S/C9H15NO3/c1-2-8(11)10-7-5-3-4-6-9(12)13/h2H,1,3-7H2,(H,10,11)(H,12,13) | | InChIKey | SAQWCPXBLNGTCC-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCNC(=O)C=C |
| | 6-ACRYLAMIDOHEXANOIC ACID Usage And Synthesis |
| Uses | 6-Acryloylaminohexanoic acid is widely used in food, health products, cosmetics and other fields. |
| | 6-ACRYLAMIDOHEXANOIC ACID Preparation Products And Raw materials |
|