- Sulfo-SMCC sodium
-
- $41.00
-
2026-08-30
- CAS:92921-24-9
- Purity: 99.57%
- Supply Ability: 10g
- SULFO-SMCC
-
-
2026-07-29
- CAS:92921-24-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kgs
- SULFO-SMCC
-
- $15.00
-
2021-07-13
- CAS:92921-24-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | SULFO-SMCC Basic information |
| | SULFO-SMCC Chemical Properties |
| Melting point | >270°C (dec.) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | H2O: soluble2.5mg/mL | | form | powder | | color | white to light brown | | Water Solubility | Soluble in water (2.5 mg/ml) and dimethyl formamide. | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C16H18N2O9S.Na.H/c19-12-5-6-13(20)17(12)8-9-1-3-10(4-2-9)16(23)27-18-14(21)7-11(15(18)22)28(24,25)26;;/h5-6,9-11H,1-4,7-8H2,(H,24,25,26);; | | InChIKey | VUFNRPJNRFOTGK-UHFFFAOYSA-M | | SMILES | O(N1C(CC(S(O)(=O)=O)C1=O)=O)C(C1CCC(CN2C(C=CC2=O)=O)CC1)=O.[NaH] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-20/21-61 | | Safety Statements | 26-45-53 | | WGK Germany | 3 | | HS Code | 29251900 | | Storage Class | 11 - Combustible Solids |
| | SULFO-SMCC Usage And Synthesis |
| Description | Sulfo-SMCC is a commonly used hetero-bifunctional, noncleavable ADC crosslinker bearing N-hydroxysuccinimide (NHS) ester and maleimide groups to react with primary amines and sulfhydryl groups, respectively. | | Chemical Properties | Solid | | Uses | A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent.
Spacer Arm: 11.6 Angstroms | | Uses | A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent. Spacer Arm: 11.6 Angstroms | | reaction suitability | reagent type: linker | | IC 50 | Non-cleavable Linker |
| | SULFO-SMCC Preparation Products And Raw materials |
|