| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | L-Aspartic acid-1-13C, N-Fmoc derivative, N-(9-Fluorenylmethoxycarbonyl)-L-aspartic acid-1-13C Basic information |
| | L-Aspartic acid-1-13C, N-Fmoc derivative, N-(9-Fluorenylmethoxycarbonyl)-L-aspartic acid-1-13C Chemical Properties |
| Melting point | 179-181 °C(lit.) | | storage temp. | 2-8°C | | form | solid | | Optical Rotation | [α]20/D -13°, c =1 in DMF | | Major Application | peptide synthesis | | InChI | 1S/C19H17NO6/c21-17(22)9-16(18(23)24)20-19(25)26-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H,20,25)(H,21,22)(H,23,24)/t16-/m0/s1/i18+1 | | InChIKey | KSDTXRUIZMTBNV-IQGYWFNKSA-N | | SMILES | OC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)[13C](O)=O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Aspartic acid-1-13C, N-Fmoc derivative, N-(9-Fluorenylmethoxycarbonyl)-L-aspartic acid-1-13C Usage And Synthesis |
| | L-Aspartic acid-1-13C, N-Fmoc derivative, N-(9-Fluorenylmethoxycarbonyl)-L-aspartic acid-1-13C Preparation Products And Raw materials |
|