| Company Name: |
Suzhou yacoo science co.,Ltd
|
| Tel: |
0512-87182056 18013166090 |
| Email: |
lingling.qi@yacoo.com.cn |
| Products Intro: |
Product Name:L-ASPARTIC ACID (1-13C)
CAS:81201-97-0
Purity:98% Package:10g;50g;1kg;5Kg;25kg;
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:L-Aspartic acid-1-13C
CAS:81201-97-0
Purity:99 atom % 13C Package:100MG Remarks:489972-100MG
|
| Company Name: |
TargetMol Chemicals Inc.
|
| Tel: |
4008200310 15002144251 |
| Email: |
marketing@tsbiochem.com |
| Products Intro: |
Product Name:L-Aspartic acid-13C
CAS:81201-97-0
Package:2mg/RMB 1370
|
|
| | L-ASPARTIC ACID (1-13C) Basic information |
| | L-ASPARTIC ACID (1-13C) Chemical Properties |
| Melting point | >300 °C (dec.) (lit.) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]25/D +25.0°, c = 2 in 5 M HCl | | InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i4+1 | | InChIKey | CKLJMWTZIZZHCS-GZPBOPPUSA-N | | SMILES | N[C@@H](CC(O)=O)[13C](O)=O | | CAS Number Unlabeled | 56-84-8 |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-ASPARTIC ACID (1-13C) Usage And Synthesis |
| Uses | L-Aspartic acid-13C is a 13C labeled L-Aspartic acid. L-Aspartic acid is is an amino acid, shown to be a suitable proagent for colon-specific agent deliverly[1][2]. | | References | [1] Leopold CS, et al. In vivo pharmacokinetic study for the assessment of poly(L-aspartic acid) as a drug carrier for colon-specific drug delivery. J Pharmacokinet Biopharm. 1995 Aug;23(4):397-406. DOI:10.1007/BF02353640
[2] Hosoya K, et al. Blood-brain barrier produces significant efflux of L-aspartic acid but not D-aspartic acid: in vivo evidence using the brain efflux index method. J Neurochem. 1999 Sep;73(3):1206-11. DOI:10.1046/j.1471-4159.1999.0731206.x |
| | L-ASPARTIC ACID (1-13C) Preparation Products And Raw materials |
|