| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(4-Aminophenyl)-4-methyl-7,8-methylenedioxy-5H-2,3-benzodiazepine hydrochloride Basic information |
| Product Name: | 1-(4-Aminophenyl)-4-methyl-7,8-methylenedioxy-5H-2,3-benzodiazepine hydrochloride | | Synonyms: | GYKI 52466 (HCl salt);GYKI 52466 hydrochloride,1-(4-Aminophenyl)-4-methyl-7,8-methylenedioxy-5H-2,3-benzodiazepine hydrochloride;4-(8-Methyl-9H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d][1,2]diazepin-5-yl)aniline hydrochloride;1-(4-AMINOPHENYL)-4-METHYL-7,8-METHYLENEDIOXY-5H-2,3-BENZODIAZEPINE HYDROCHLORIDE;GYKI 52466 hydrochloride solid;Benzenamine, 4-(8-methyl-9H-1,3-dioxolo[4,5-h][2,3]benzodiazepin-5-yl)-, hydrochloride (1:1) | | CAS: | 192065-56-8 | | MF: | C17H15N3O2HCl | | MW: | 329.78 | | EINECS: | | | Product Categories: | | | Mol File: | 192065-56-8.mol |  |
| | 1-(4-Aminophenyl)-4-methyl-7,8-methylenedioxy-5H-2,3-benzodiazepine hydrochloride Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO: soluble0.39mg/mL | | form | solid | | color | yellow | | InChI | 1S/C17H15N3O2.ClH/c1-10-6-12-7-15-16(22-9-21-15)8-14(12)17(20-19-10)11-2-4-13(18)5-3-11;/h2-5,7-8H,6,9,18H2,1H3;1H | | InChIKey | RUBSCPARMVJNKX-UHFFFAOYSA-N | | SMILES | Cl[H].CC1=NN=C(c2ccc(N)cc2)c3cc4OCOc4cc3C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1-(4-Aminophenyl)-4-methyl-7,8-methylenedioxy-5H-2,3-benzodiazepine hydrochloride Usage And Synthesis |
| Uses | GYKI 52466 hydrochloride has been used as an α-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid (AMPA) receptor selective antagonist in cell viability assays to evaluate the specificity of kainate (KA) effect on cerebellar granule cells (CGCs). It has also been used as an AMPA blocker to study the function of glutamate in neuroadapted sindbis virus (NSV) -induced motor neuron death. | | Biochem/physiol Actions | GYKI 52466 serves as an antagonist of several processes, mediated by glutamate. | | in vivo | GYKI 52466 hydrochloride (intraperitoneal injection; 1.76-13.2 mg/kg; once) treatment provides potent anticonvulsant protection against sound-induced seizures in DBA/2 mice[2]. |
| | 1-(4-Aminophenyl)-4-methyl-7,8-methylenedioxy-5H-2,3-benzodiazepine hydrochloride Preparation Products And Raw materials |
|