- Epoxiconazole
-
- $41.00 / 10mg
-
2026-04-13
- CAS:133855-98-8
- Min. Order:
- Purity: 98.57%
- Supply Ability: 10g
|
| | 1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole Basic information |
| Product Name: | 1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole | | Synonyms: | EPOXICONAZOL;1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;(2RS,3RS)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxirane;Epoxiconazol Solution, 1000ppm;1-[[(2S,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;Epoxiconazole Impurity 1;Epoxiconazole@100 μg/mL in Methanol;Epoxiconazole@1000 μg/mL in Methanol | | CAS: | 133855-98-8 | | MF: | C17H13ClFN3O | | MW: | 329.76 | | EINECS: | 406-850-2 | | Product Categories: | | | Mol File: | 133855-98-8.mol | ![1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole Structure](CAS/GIF/133855-98-8.gif) |
| | 1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole Chemical Properties |
| Boiling point | 463.1±55.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 2.75±0.10(Predicted) | | form | Solid | | color | White to off-white | | Water Solubility | 8.42mg/L at 20℃ | | BRN | 9509539 | | InChI | 1S/C17H13ClFN3O/c18-15-4-2-1-3-14(15)16-17(23-16,9-22-11-20-10-21-22)12-5-7-13(19)8-6-12/h1-8,10-11,16H,9H2/t16-,17+/m0/s1 | | InChIKey | ZMYFCFLJBGAQRS-DLBZAZTESA-N | | SMILES | Fc1ccc(cc1)[C@@]3(Cn2cncn2)O[C@@H]3c4ccccc4Cl | | LogP | 3.33 at 25℃ | | EPA Substance Registry System | Epoxiconazole (133855-98-8) |
| Hazard Codes | Xn,N,T | | Risk Statements | 40-51/53-62-63-61 | | Safety Statements | 36/37-46-61-45-53 | | RIDADR | UN 3077 | | WGK Germany | 3 | | RTECS | XZ4500100 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Chronic 2
Carc. 2
Repr. 1B |
| | 1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole Usage And Synthesis |
| Uses | 1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole is a fungicide used to inhibit the metabolism and growth of mycelia. | | Definition | ChEBI: (2S,3R)-epoxiconazole is the (2S,3R)-stereoisomer of 1-{[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl}-1H-1,2,4-triazole. It is an enantiomer of a (2R,3S)-epoxiconazole. | | Flammability and Explosibility | Not classified |
| | 1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole Preparation Products And Raw materials |
|