- Zaltoprofen
-
- $34.00
-
2026-08-08
- CAS:74711-43-6
- Purity: 99.72%
- Supply Ability: 10g
- Zaltoprofen
-
-
2025-12-25
- CAS:74711-43-6
- Min. Order: 1gram
- Purity: 99%
- Supply Ability: 10kg
|
| | 10,11-Dihydro-alpha-methyl-10-oxo-dibenzo[b,f]thiepin-2-acetic acid Basic information |
| Product Name: | 10,11-Dihydro-alpha-methyl-10-oxo-dibenzo[b,f]thiepin-2-acetic acid | | Synonyms: | 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid;Zaltoprofen/ 10,11-Dihydro-alpha-Methyl-10-oxo-dibenzo[b,f]thiepin-2-acetic acid;Salafapinon;Soleton;Dibenzo(B,F)thiepin-2-acetic acid, 10,11-dihydro-alpha-methyl-10-oxo-;Einecs 277-973-5;Zaltoprofen (unspecified);CAS No:74711-43-6 Dibenzo[b,f]thiepin-2-aceticacid, 10,11-dihydro-a-Methyl-10-oxo- | | CAS: | 74711-43-6 | | MF: | C17H14O3S | | MW: | 298.36 | | EINECS: | 277-973-5 | | Product Categories: | Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals;Zaltoprofen | | Mol File: | 74711-43-6.mol | ![10,11-Dihydro-alpha-methyl-10-oxo-dibenzo[b,f]thiepin-2-acetic acid Structure](CAS/GIF/74711-43-6.gif) |
| | 10,11-Dihydro-alpha-methyl-10-oxo-dibenzo[b,f]thiepin-2-acetic acid Chemical Properties |
| Melting point | 129-1310C | | Boiling point | 500.5±50.0 °C(Predicted) | | density | 1.329±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.21±0.10(Predicted) | | color | Off-White to Pale Yellow | | Merck | 14,10112 | | InChI | InChI=1S/C17H14O3S/c1-10(17(19)20)11-6-7-15-12(8-11)9-14(18)13-4-2-3-5-16(13)21-15/h2-8,10H,9H2,1H3,(H,19,20) | | InChIKey | MUXFZBHBYYYLTH-UHFFFAOYSA-N | | SMILES | C(C1=CC=C2SC3=CC=CC=C3C(CC2=C1)=O)(C)C(=O)O |
| RTECS | HQ2526700 | | HS Code | 2934.99.4400 |
| | 10,11-Dihydro-alpha-methyl-10-oxo-dibenzo[b,f]thiepin-2-acetic acid Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | Zaltoprofen is a non-steroidal anti-inflammatory drug. It inhibits bradykinin-induced pain responses without blocking bradykinin receptors. | | Uses | Anti-inflammatory activity resides in (S)-enantiomer. | | Definition | ChEBI: Zaltoprofen is an organic molecular entity. | | in vivo | Zaltoprofen (5-20 mg/kg; a single p.o.) inhibits bradykinin-induced nociceptive responses in rats[2].
Zaltoprofen (3-30 mg/kg; a single p.o.) inhibits the acetic acid-induced writhing response of mice in a dose-dependent manner[2]. | Animal Model: | Eight-week-old male Wistar rats were injected Bradykinin every 15 min[2] | | Dosage: | 5, 10, 20 mg/kg | | Administration: | A single p.o. | | Result: | Inhibited bradykinin-induced nociceptive responses, with an ED50 of 9.7 mg/kg.
The duration of analgesic effect was 60-90 min. |
| | IC 50 | COX-2: 0.34 μM (IC50); COX-1: 1.3 μM (IC50) |
| | 10,11-Dihydro-alpha-methyl-10-oxo-dibenzo[b,f]thiepin-2-acetic acid Preparation Products And Raw materials |
|