|
|
| | Boc-3-Aminomethylbenzoic acid Basic information |
| | Boc-3-Aminomethylbenzoic acid Chemical Properties |
| Boiling point | 434.6±38.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder or Flakes | | pka | 4.21±0.10(Predicted) | | color | White to off-white | | BRN | 6957774 | | Major Application | peptide synthesis | | InChI | 1S/C13H17NO4/c1-13(2,3)18-12(17)14-8-9-5-4-6-10(7-9)11(15)16/h4-7H,8H2,1-3H3,(H,14,17)(H,15,16) | | InChIKey | MQNHKLMHRZYTBZ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCc1cccc(c1)C(O)=O | | CAS DataBase Reference | 117445-22-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Boc-3-Aminomethylbenzoic acid Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | 3-(Boc-aminomethyl)benzoic Acid is used to synthesize aminodihydroquinazolines as inhibitors of BACE-1 (β-site APP cleaving enzyme). It is also used to prepare spiro[1H-indene-1,4''-piperidine] derivatives as potent and selective non-peptide human somatostatin receptor subtype 2 (sst2) agonists. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | Synthesis | General procedure for the synthesis of 3-(N-Boc-aminomethyl)benzoic acid from methyl 3-(((tert-butoxycarbonyl)amino)methyl)benzoate: to a solution of methyl 3-(((tert-butoxycarbonyl)amino)methyl)benzoate (0.6 g, 2.20 mmol) in tetrahydrofuran (THF, 4 mL) at 25°C was added lithium hydroxide (0.3 g, 9.0 mmol) solution in water (2 mL). The reaction mixture was stirred at 50°C for 4 hours. Upon completion of the reaction, THF was removed by distillation under reduced pressure, the reaction mixture was acidified with acetic acid, and the product was subsequently extracted with ethyl acetate. The organic phase was dried with anhydrous sodium sulfate, filtered and concentrated to give the crude product. The crude product was purified by column chromatography to give 3-(N-Boc-aminomethyl)benzoic acid as a colorless solid (250 mg, 44% yield). | | References | [1] Patent: WO2011/21209, 2011, A1. Location in patent: Page/Page column 71; 72
[2] Patent: US2012/101099, 2012, A1. Location in patent: Page/Page column 28-30 |
| | Boc-3-Aminomethylbenzoic acid Preparation Products And Raw materials |
|