| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4,5-Dioctyloxy-1,2-benzenedicarbonitrile Basic information |
| Product Name: | 4,5-Dioctyloxy-1,2-benzenedicarbonitrile | | Synonyms: | 4,5-DIOCTYLOXY-1,2-BENZENEDICARBONITRILE 97%;4,5-bis(octyloxy)-1,2-benzenedicarbonitrile;4,5-dioctoxybenzene-1,2-dicarbonitrile;1,2-Benzenedicarbonitrile, 4,5-bis(octyloxy)-;4,5-Bis(octyloxy)phthalonitrile;4,5-DIOCTYLOXYPHTHALONITRILE;4,5-Dioctyloxy-1,2-benzenedicarbonitrile | | CAS: | 118132-11-9 | | MF: | C24H36N2O2 | | MW: | 384.55 | | EINECS: | | | Product Categories: | Building Blocks;C10 to C27;Chemical Synthesis;Cyanides/Nitriles;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 118132-11-9.mol |  |
| | 4,5-Dioctyloxy-1,2-benzenedicarbonitrile Chemical Properties |
| Melting point | 106-108 °C(lit.) | | Boiling point | 529.3±50.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | form | solid | | InChI | 1S/C24H36N2O2/c1-3-5-7-9-11-13-15-27-23-17-21(19-25)22(20-26)18-24(23)28-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 | | InChIKey | SSVVHLRGCJLWCP-UHFFFAOYSA-N | | SMILES | CCCCCCCCOc1cc(C#N)c(cc1OCCCCCCCC)C#N |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 4,5-Dioctyloxy-1,2-benzenedicarbonitrile Usage And Synthesis |
| Uses | 4,5-Dioctyloxy-1,2-benzenedicarbonitrile (4,5-Dioctyloxyphthalonitrile) may be used for the preparation of new unsymmetrically substituted DB24C8-phthalocyanines. It may be used for the synthesis of tetrathiafluvalene (TTF)-annulated symmetrical and unsymmetrical phthalocyanines. |
| | 4,5-Dioctyloxy-1,2-benzenedicarbonitrile Preparation Products And Raw materials |
|