| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (+)-4-[2-Hydroxy-3-[(1-methylethyl)-amino]propoxy]benzeneacetamide Basic information |
| | (+)-4-[2-Hydroxy-3-[(1-methylethyl)-amino]propoxy]benzeneacetamide Chemical Properties |
| Melting point | 148-152 °C(lit.) | | Boiling point | 508.0±50.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | 45% (w/v) aq 2-hydroxypropyl-β-cyclodextrin: >6.0 mg/mL | | pka | 13.88±0.20(Predicted) | | form | solid | | color | pale yellow | | Optical Rotation | [α]25/D +16°, c = 1 in 1 M HCl | | InChI | InChI=1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18)/t12-/m1/s1 | | InChIKey | METKIMKYRPQLGS-GFCCVEGCSA-N | | SMILES | C1(CC(N)=O)=CC=C(OC[C@H](O)CNC(C)C)C=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (+)-4-[2-Hydroxy-3-[(1-methylethyl)-amino]propoxy]benzeneacetamide Usage And Synthesis |
| Description | (+)-Atenolol is an enantiomer of the β1-adrenergic receptor (β1-AR) antagonist (±)-atenolol . (+)-Atenolol inhibits radioligand binding to β-ARs on sarcolemma-enriched membranes (Ki = 8.61 μM). Unlike (–)-atenolol and (±)-antenolol, (+)-atenolol has no effect on blood pressure in spontaneously hypertensive rats. | | Uses | Cardioselective β-adrenergic blocker. Antihypertensive, antianginal, antiarrhythmic (class II). | | Uses | Antihypertensor | | Uses | less active enantiomer | | Definition | ChEBI: The (R)-enantiomer of atenolol. | | IC 50 | β adrenergic receptor | | references | [1] stoschitzky k, egginger g, zernig g, et al. stereoselective features of (r)- and (s)-atenolol: clinical pharmacological, pharmacokinetic, and radioligand binding studies[j]. chirality, 1993, 5(1): 15-19. |
| | (+)-4-[2-Hydroxy-3-[(1-methylethyl)-amino]propoxy]benzeneacetamide Preparation Products And Raw materials |
|