|
|
| | Methylamine-d5 deuteriochloride Basic information |
| Product Name: | Methylamine-d5 deuteriochloride | | Synonyms: | METHYLAMINE-D5 DCL;METHYLAMMONIUM-D6 CHLORIDE;[2H6]methylammonium chloride;Methylamine-d5 deuteriochloride,for NMR,98+ atom % D;methylamine-d5deuterochloride;Hydrochloric acid-d, compd. with methanamine-d5 (1:1);Methylamine-d5 deuteriochloride;Methylamine-d5 deuteriochloride | | CAS: | 14779-55-6 | | MF: | CD5N.ClD | | MW: | 73.55 | | EINECS: | 238-848-0 | | Product Categories: | | | Mol File: | 14779-55-6.mol |  |
| | Methylamine-d5 deuteriochloride Chemical Properties |
| Melting point | 232-234 °C(lit.) | | form | solid | | InChI | 1S/CH5N.ClH/c1-2;/h2H2,1H3;1H/i1D3;/hD3 | | InChIKey | NQMRYBIKMRVZLB-MIOFBDNISA-N | | SMILES | Cl[2H].[2H]N([2H])C([2H])([2H])[2H] | | CAS DataBase Reference | 14779-55-6 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Methylamine-d5 deuteriochloride Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Methylamine-d5 DCl (CAS# 14779-55-6) is a useful isotopically labeled research compound. |
| | Methylamine-d5 deuteriochloride Preparation Products And Raw materials |
|