| Company Name: |
CR Corporation Limited |
| Tel: |
|
| Email: |
fred.wen@crcorporation.cn |
| Products Intro: |
Product Name:1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-iodoundecane CAS:200112-75-0
|
|
|
|
|
| Company Name: |
Aladdin Scientific |
| Tel: |
|
| Email: |
tp@aladdinsci.com |
| Products Intro: |
Product Name:4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl iodide CAS:200112-75-0 Purity:97% Package:$68.9/250mg;$205.9/1g;$686.9/5g;Bulk package Remarks:97%
|
|
|
|
|
| Company Name: |
Hangzhou Fuze Pharmaceutical Technology Co., Ltd. Gold
|
| Tel: |
0572-0571-82870240 13586109179 |
| Email: |
47302108@qq.com |
| Products Intro: |
Product Name:1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-iodoundecane CAS:200112-75-0 Purity:95% Package:>1KG Remarks:FZ10025
|
|
| | 3-(PERFLUOROOCTYL)PROPYL IODIDE Basic information |
| Product Name: | 3-(PERFLUOROOCTYL)PROPYL IODIDE | | Synonyms: | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-HEPTADECAFLUOROUNDECYL IODIDE;3-(PERFLUOROOCTYL)PROPYL IODIDE;1H,1H,2H,2H,3H,3H-PERFLUOROUNDECYL IODIDE;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-11-IODOUNDECANE;3-(Perfluorooctyl)propyl iodide, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluoro-11-iodoundecane, 1H,1H,2H,2H,3H,3H-Perfluoroundecyl iodide;3-Perfluorooctyl-1-iodopropane;3-(Perfluorooct-1-yl)propyl iodide, 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl iodide;4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl iodide >=99% | | CAS: | 200112-75-0 | | MF: | C11H6F17I | | MW: | 588.04 | | EINECS: | | | Product Categories: | | | Mol File: | 200112-75-0.mol |  |
| | 3-(PERFLUOROOCTYL)PROPYL IODIDE Chemical Properties |
| Melting point | 32-36°C | | storage temp. | 2-8°C, protect from light | | form | powder | | Appearance | White to yellow Solid | | InChI | InChI=1S/C11H6F17I/c12-4(13,2-1-3-29)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h1-3H2 | | InChIKey | AXUBYTAXJHIPJO-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCI | | EPA Substance Registry System | 3-(Perfluorooctyl)propyl iodide (200112-75-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
| | 3-(PERFLUOROOCTYL)PROPYL IODIDE Usage And Synthesis |
| Uses | 3-(Perfluorooctyl)propyl iodide (CAS# 200112-75-0) is a perfluoroalkyl-containing building block used in the preparation of fluoroalkylalkylthiols via Zemplen deacylation. It is also used in the automated fluorous-assisted solution-phase oligosaccharide synthesis via activation of thioglycoside donors. |
| | 3-(PERFLUOROOCTYL)PROPYL IODIDE Preparation Products And Raw materials |
|