| Company Name: |
Finetech Industry Limited |
| Tel: |
+86-27-8746-5837 +8619945049750 |
| Email: |
info@finetechnology-ind.com |
| Products Intro: |
Product Name:1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-iodooctane
CAS:2043-57-4
Purity:98% Package:1g,10g,25g,100g,500g,1kg
|
|
|
|
|
| Company Name: |
Henan Fengda Chemical Co., Ltd |
| Tel: |
+86-371-86557731 +86-13613820652 |
| Email: |
info@fdachem.com |
| Products Intro: |
Product Name:1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-iodooctane
CAS:2043-57-4
Purity:99% Package:1KG;6USD|1000KG;0.2USD
|
|
|
|
|
- Perfluorooctyliodide
-
- $20.00 / 1KG
-
2026-02-03
- CAS:2043-57-4
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200 tons/ year
|
| | 1H,1H,2H,2H-Perfluorooctyl iodide Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluorooctyl iodide | | Synonyms: | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo-octan;1,1,2,2-Tetrahydroperfluorooctyliodide;2-Perfluorohexyl-1-iodoethane;2-(PERFLUOROHEXYL)ETHYL IODIDE;3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUORO-1-IODOOCTANE;3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL IODIDE;1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-IODOOCTANE;1-IODO-1H,1H,2H,2H-PERFLUOROOCTANE | | CAS: | 2043-57-4 | | MF: | C8H4F13I | | MW: | 474 | | EINECS: | 218-056-1 | | Product Categories: | | | Mol File: | 2043-57-4.mol |  |
| | 1H,1H,2H,2H-Perfluorooctyl iodide Chemical Properties |
| Melting point | 21 °C | | Boiling point | 92 °C45 mm Hg(lit.) | | density | 1.934 g/mL at 25 °C(lit.) | | vapor pressure | 24-429Pa at 20-50℃ | | refractive index | n20/D 1.359(lit.) | | Fp | 177 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Liquid | | color | Clear | | Water Solubility | insoluble | | Sensitive | Light Sensitive | | BRN | 1887105 | | Stability: | Volatile | | InChI | 1S/C8H4F13I/c9-3(10,1-2-22)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2 | | InChIKey | CHTNKOVIYUCLTB-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI | | LogP | 3.8 at 20℃ and pH6.6-7.1 | | CAS DataBase Reference | 2043-57-4(CAS DataBase Reference) | | EPA Substance Registry System | Octane, 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo- (2043-57-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 8 | | Hazard Note | Harmful | | TSCA | TSCA listed | | HazardClass | IRRITANT-HARMFUL | | HS Code | 29037790 | | Storage Class | 10 - Combustible liquids |
| | 1H,1H,2H,2H-Perfluorooctyl iodide Usage And Synthesis |
| Chemical Properties | clear liquid | | Uses | Perfluorohexylethyl Iodide, is a Polyfluorinated iodine alkanes (PFIs), which are important intermediates in the synthesis of organic fluoride products. It has also been shown to have potential estrogenic effects. |
| | 1H,1H,2H,2H-Perfluorooctyl iodide Preparation Products And Raw materials |
| Preparation Products | 1H,1H,2H,2H-PERFLUOROOCTANETHIOL-->Diethyl (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-yl)phosphonate-->1H,1H,2H,2H-PERFLUORO-1-OCTANOL |
|