|
|
| | 4,6-Dichloro-2-methylpyrimidine-5-carbaldehyde Basic information | | Uses |
| Product Name: | 4,6-Dichloro-2-methylpyrimidine-5-carbaldehyde | | Synonyms: | 4,6-Dichloro-2-Methyl-5-pyriMidinecarboxaldehyde;4,6-Dichloro-2-methyl-5-pyrimidinecarbaldehyde;5-Pyrimidinecarboxaldehyde, 4,6-dichloro-2-methyl-;4,6-DICHLORO-2-METHYLPYRIMIDINE-5-CARBALDEHYDE ISO 9001:2015 REACH;4,6-dichloro-2-methylpyrimidine-5-formaldehyde;4,6-Dichloro-2-methylpyrimidin-5-carbaldehyde;2-Methyl-4,6-dichloropyrimidin-5-formaldehyde;4,6-Dichloro-2-methylpyrimidine-5-carbaldehyde | | CAS: | 14160-91-9 | | MF: | C6H4Cl2N2O | | MW: | 191.01 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 14160-91-9.mol |  |
| | 4,6-Dichloro-2-methylpyrimidine-5-carbaldehyde Chemical Properties |
| Boiling point | 276.2±35.0 °C(Predicted) | | density | 1.495±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -5.44±0.39(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C6H4Cl2N2O/c1-3-9-5(7)4(2-11)6(8)10-3/h2H,1H3 | | InChIKey | DOMBYPXLCGLBRD-UHFFFAOYSA-N | | SMILES | C1(C)=NC(Cl)=C(C=O)C(Cl)=N1 |
| | 4,6-Dichloro-2-methylpyrimidine-5-carbaldehyde Usage And Synthesis |
| Uses | 2-Methyl-4,6-dichloropyrimidine-5-carboxaldehyde is an aldehyde derivative that can be used as a pharmaceutical intermediate. | | Synthesis | The general procedure for the synthesis of 2-methyl-4,6-dichloropyrimidine-5-carbaldehyde from 2N-(4-((3-propylamino)amino)phenyl)-4N-(5-cyclopropane-1H-pyrazolyl)pyrimidine-2,4-diamine hydrochloride is as follows:
Intermediate 45: Synthesis of 4,6-dichloro-2-methylpyrimidine-5-carbaldehyde
1. water (0.199 mL, 11.03 mmol) was slowly added to phosphorus trichloride (7.28 mL, 78.11 mmol) under ice bath conditions.
2. N,N-dimethylaniline (0.291 mL, 2.30 mmol) was then added.
3. N-((4,6-dihydroxy-2-methylpyrimidin-5-yl)methylene)-N-methylmethylammonium chloride (Intermediate 46; 1 g, 4.59 mmol) was added to the above solution in batches at room temperature.
4. The resulting suspension was stirred and reacted at 120 °C for 20 hours.
5. Upon completion of the reaction, the reaction mixture was slowly poured into an ice/chloroform mixture.
6. The chloroform layer was washed sequentially with saturated NaHCO3 solution (200 mL) and saturated brine (100 mL).
7. The organic layer was dried over anhydrous Na2SO4, filtered and concentrated under reduced pressure to give the crude product.
8. The crude product was purified by fast silica gel column chromatography with an elution gradient of 5% to 10% EtOAc in isohexane solution.
9. The pure grades were collected and concentrated to dryness under reduced pressure to give 2-methyl-4,6-dichloropyrimidine-5-carbaldehyde (0.160 g, yield 18.23%) as a white solid.
Product characterization: 1H NMR (400 MHz, CDCl3) δ 2.77 (3H, s), 10.44 (1H, s). | | References | [1] Patent: WO2011/121350, 2011, A1. Location in patent: Page/Page column 118-119 |
| | 4,6-Dichloro-2-methylpyrimidine-5-carbaldehyde Preparation Products And Raw materials |
|