|
|
| | 1-METHYLAZETIDIN-3-AMINE Basic information |
| Product Name: | 1-METHYLAZETIDIN-3-AMINE | | Synonyms: | 1-METHYLAZETIDIN-3-AMINE;3-amino-N-methylazetidine;3-Amino-1-methylazetidine;3-Azetidinamine, 1-methyl-;1-Methyl-azetidin-3-ylamine;Ranelic Acid Impurity 3;1-Methylazetidin-3-amine - [M0108];1-Methyl-3-azetidinamine | | CAS: | 959957-92-7 | | MF: | C4H10N2 | | MW: | 86.14 | | EINECS: | | | Product Categories: | | | Mol File: | 959957-92-7.mol |  |
| | 1-METHYLAZETIDIN-3-AMINE Chemical Properties |
| Boiling point | 84.2±8.0 °C(Predicted) | | density | 0.961±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.22±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H10N2/c1-6-2-4(5)3-6/h4H,2-3,5H2,1H3 | | InChIKey | BIWZYRJXBPPLLA-UHFFFAOYSA-N | | SMILES | N1(C)CC(N)C1 |
| RIDADR | UN1760 | | HS Code | 2922390090 |
| | 1-METHYLAZETIDIN-3-AMINE Usage And Synthesis |
| Uses | 1-Methylazetidin-3-amine is an organic amine compound, frequently used as a pharmaceutical synthesis intermediate. Within the biological sciences, it is a key component in the preparation of melanocortin-2 receptor (MC2R) antagonist intermediates. |
| | 1-METHYLAZETIDIN-3-AMINE Preparation Products And Raw materials |
|