|
|
| | (R)-N-Fmoc-2-(2'-propylenyl)alanine Basic information |
| | (R)-N-Fmoc-2-(2'-propylenyl)alanine Chemical Properties |
| Boiling point | 564.3±45.0 °C(Predicted) | | density | 1.224 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | liquid | | pka | 3.81±0.11(Predicted) | | color | pale yellow | | InChI | InChI=1S/C21H21NO4/c1-3-12-21(2,19(23)24)22-20(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h3-11,18H,1,12-13H2,2H3,(H,22,25)(H,23,24)/t21-/m1/s1 | | InChIKey | FNCSRFHDUZYOCR-OAQYLSRUSA-N | | SMILES | C(O)(=O)[C@@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CC=C |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | TSCA | No |
| | (R)-N-Fmoc-2-(2'-propylenyl)alanine Usage And Synthesis |
| Uses | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpent-4-enoic acid is an alanine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | (R)-N-Fmoc-2-(2'-propylenyl)alanine Preparation Products And Raw materials |
|