Fmoc-α-methyl-L-Leucine manufacturers
- Fmoc-α-Me-Leu-OH
-
-
2026-09-11
- CAS:312624-65-0
- Min. Order: 1kg
- Purity: 98%+
- Supply Ability: 1T+
|
| | Fmoc-α-methyl-L-Leucine Basic information |
| Product Name: | Fmoc-α-methyl-L-Leucine | | Synonyms: | FMoc-alphaMe-L-Leu-OH;Fmoc-α-Me-L-Leucine;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2,4-dimethylpentanoic acid;(9H-Fluoren-9-yl)MethOxy]Carbonyl Alpha-Methyl-Leu-OH;Fmoc-alpha-Me-L-Leucine;N-Fmoc-a-Methyl-L-leucine;(S)-N-Fmoc-α-Methylleucine, >97%;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2 | | CAS: | 312624-65-0 | | MF: | C22H25NO4 | | MW: | 367.44 | | EINECS: | | | Product Categories: | α-Methyl Amino Acids | | Mol File: | 312624-65-0.mol |  |
| | Fmoc-α-methyl-L-Leucine Chemical Properties |
| Boiling point | 562.7±33.0 °C(Predicted) | | density | 1.189±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.95±0.41(Predicted) | | form | powder | | color | white | | InChI | InChI=1S/C22H25NO4/c1-14(2)12-22(3,20(24)25)23-21(26)27-13-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,14,19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t22-/m0/s1 | | InChIKey | LKQDQIGTIVQHMG-QFIPXVFZSA-N | | SMILES | C(O)(=O)[C@](C)(CC(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | Fmoc-α-methyl-L-Leucine Usage And Synthesis |
| Description |
Fmoc-α-methyl-L-Leucine is an Fmoc-protected leucine derivative that can be valuable in proteomics research and solid-phase peptide synthesis.
| | Chemical Properties | White powder | | Uses | Fmoc-α-Me-Leu-OH is a leucine derivative with an Fmoc protecting group, which can be used to synthesize peptides with oxytocin receptor agonist activity[1]. | | References | [1] Caterina Bissantz, et al. Peptides as oxytocin agonists. WO2015185584A1. 2015-06-03 |
| | Fmoc-α-methyl-L-Leucine Preparation Products And Raw materials |
|