| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | D-102 Dye Basic information |
| Product Name: | D-102 Dye | | Synonyms: | D-102 Dye;5-[[4-[4-(2,2-Diphenylethenyl)phenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]Methylene]-4-oxo-2-thioxo-3-thiazolidineacetic Acid;(5-{4-[4-(2,2-Diphenylvinyl)phenyl]-1,2,3,3a ,4,8b-hexahydro-cyclopenta[b]indol-7-ylMethylene}-4-oxo-2-thioxo-thiazolidin-3-yl)acetic acid;Mitsubishi D 102;D 102 D 102;2-[(5Z)-5-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;D102>;3-Thiazolidineacetic acid, 5-[[4-[4-(2,2-diphenylethenyl)phenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]methylene]-4-oxo-2-thioxo- | | CAS: | 652145-28-3 | | MF: | C37H30N2O3S2 | | MW: | 614.78 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Sulfur & Selenium Compounds | | Mol File: | 652145-28-3.mol |  |
| | D-102 Dye Chemical Properties |
| Melting point | 238-243°C | | Boiling point | 778.137±70.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.426±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 3.359±0.10(predicted) | | form | powder | | color | Yellow to Amber to Dark red | | λmax | 505nm(CH2Cl2)(lit.) | | InChIKey | XGMCROHUTRXETK-VQNDASPWSA-N | | SMILES | S=C(S/C1=C\C(C=C2)=CC3=C2N(C4=CC=C(C=C(C5=CC=CC=C5)C6=CC=CC=C6)C=C4)C7C3CCC7)N(CC(O)=O)C1=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 3204.19.5000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | D-102 Dye Usage And Synthesis |
| Uses | Organic dye for highly efficient solid-state dye-sensitized solar cells. | | Uses | D102 Dye can be used as a sensitizing material that can be coated on the semiconducting electrode for the fabrication of metal-free dye sensitized solar cells. | | General Description | D102 Dye is a low cost indoline based organic dye that can be used as a photosensitizer. Its power conversion efficiency is over 4% with a strong absorption coefficient (55800 Lmol-1cm-1 at 490nm). It has a high extinction coefficient in comparison to the ruthenium dye. It can improve the performance of electrochemical devices. |
| | D-102 Dye Preparation Products And Raw materials |
|