|
|
| | D-149 Dye Basic information |
| Product Name: | D-149 Dye | | Synonyms: | D149 DYE, >95%;Indoline dye D149, >95%;D-149 Dye;5-[[4-[4-(2,2-Diphenylethenyl)phenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]methylene]-2-(3-ethyl-4-oxo-2-thioxo-5-thiazolidinylidene)-4-oxo-3-thiazolidineacetic acid;D 149;D 149(D149 Dye,Indoline dye D149);Indoline dye D149;D149 Dye 98% (HPLC) | | CAS: | 786643-20-7 | | MF: | C42H35N3O4S3 | | MW: | 741.94 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Sulfur & Selenium Compounds | | Mol File: | 786643-20-7.mol |  |
| | D-149 Dye Chemical Properties |
| Melting point | 284-289°C | | Boiling point | 857.1±75.0 °C(Predicted) | | density | 1.47 | | form | Solid | | pka | 3.48±0.10(Predicted) | | color | Light brown to black | | λmax | 531 nm | | InChIKey | OZFUEQNYOBIXTB-SJIUXOFISA-N | | SMILES | CCN1C(=S)SC(\C1=O)=C2\SC(=C/c3ccc4N(C5CCCC5c4c3)c6ccc(cc6)\C=C(\c7ccccc7)c8ccccc8)\C(=O)N2CC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-149 Dye Usage And Synthesis |
| Uses | Organic dye for highly efficient solid-state dye-sensitized solar cells. | | Uses | D149 dye can be used as an organic dye to enhance the absorption of dye sensitized solar cells (DSSCs). | | General Description | D149 Dye is an indoline dye that has an extinction coefficient of 68700 mol-1cm. It has a high conversion efficiency and can be used as a sensitizer. |
| | D-149 Dye Preparation Products And Raw materials |
|