| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Purple dye Basic information |
| Product Name: | Purple dye | | Synonyms: | 5-[[4-[4-(2,2-Diphenylethenyl)phenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]methylene]-2-(3-octyl-4-oxo-2-thioxo-5-thiazolidinylidene)-4-oxo-3-thiazolidineacetic acid;D205 Dye;Indoline dye D205;Purple dye;D205 Dye 97% (HPLC);3-Thiazolidineacetic acid, 5-[[4-[4-(2,2-diphenylethenyl)phenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]methylene]-2-(3-octyl-4-oxo-2-thioxo-5-thiazolidinylidene)-4-oxo- | | CAS: | 936336-21-9 | | MF: | C48H47N3O4S3 | | MW: | 826.1 | | EINECS: | | | Product Categories: | | | Mol File: | 936336-21-9.mol |  |
| | Purple dye Chemical Properties |
| Melting point | 247-252°C | | Boiling point | 895.8±75.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | form | powder | | pka | 3.48±0.10(Predicted) | | λmax | 531392 nm | | InChIKey | WZGXSNHXTGGEGJ-PHBNZWDISA-N | | SMILES | S=C(N(CCCCCCCC)C/1=O)SC1=C(S/C2=C\C(C=C3)=CC4=C3N(C5=CC=C(C=C(C6=CC=CC=C6)C7=CC=CC=C7)C=C5)C8C4CCC8)/N(CC(O)=O)C2=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Purple dye Usage And Synthesis |
| Uses | Photosensitive Red-Violet dye having excellent photoelectric conversion efficiency as a metal-free dye.
Efficiency of DSSC device - > 9.5%
Cell area: 0.25 cm2 (0.5 cm × 0.5 cm)
TiO2 Thickness: 5 μm
TiO2: screen printing
Electrolyte: 0.1 M LiI; 0.05 M I2; 0.6 M Dimethylpropylimidazolium
Iodide; 0.05 M t-Butylpyridine in 3-Methoxypropionitrile
Light source: AM1.5
Counter Electrode: Pt/Cr spatter glass
Dye adsorption: 30 °C/ in 3 hr. (t-BuOH/acetonitrile soln.) | | General Description | D205 Dye is an indoline dye widely used as an organic sensitizer that can be coated on metal oxide to improve its efficiency. It is majorly used in the development of high performing energy based devices. |
| | Purple dye Preparation Products And Raw materials |
|