|
|
| | N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)glycine 1,1'-bis[2-(octyloxy)ethyl] ester Basic information |
| Product Name: | N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)glycine 1,1'-bis[2-(octyloxy)ethyl] ester | | Synonyms: | N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)glycine 1,1'-bis[2-(octyloxy)ethyl] ester;DP-BAPTA-99;DPBAPTA-99;Glycine, N,N'-[1,2-ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)-, 1,1'-bis[2-(octyloxy)ethyl] ester | | CAS: | 222315-88-0 | | MF: | C42H64N2O12 | | MW: | 788.96 | | EINECS: | | | Product Categories: | | | Mol File: | 222315-88-0.mol | ![N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)glycine 1,1'-bis[2-(octyloxy)ethyl] ester Structure](CAS/20180906/GIF/222315-88-0.gif) |
| | N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)glycine 1,1'-bis[2-(octyloxy)ethyl] ester Chemical Properties |
| Melting point | 121-122 °C | | Boiling point | 864.8±65.0 °C(Predicted) | | density | 1.161 | | form | Solid | | pka | 2.00±0.10(Predicted) | | color | White to light yellow | | InChIKey | FTGBVHPWUIHWRH-UHFFFAOYSA-N | | SMILES | C(OC1=CC=CC=C1N(CC(O)=O)CC(OCCOCCCCCCCC)=O)COC1=CC=CC=C1N(CC(O)=O)CC(OCCOCCCCCCCC)=O |
| | N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)glycine 1,1'-bis[2-(octyloxy)ethyl] ester Usage And Synthesis |
| Uses | DP-b99 is a chelator of zinc and calcium ions that acts selectively within cell membranes and has neuroprotective properties in animal models of stroke. | | References | [1] Kalendarev T, Zupkovitz G, Ioffe V. The unusual gradient elution for reversed phase HPLC of a strong chelator as an active drug substance. J Pharm Biomed Anal. 2001;24(5-6):967-975. DOI:10.1016/s0731-7085(00)00567-7 [2] Diener HC, Schneider D, Lampl Y, Bornstein NM, Kozak A, Rosenberg G. DP-b99, a membrane-activated metal ion chelator, as neuroprotective therapy in ischemic stroke. Stroke. 2008;39(6):1774-1778. DOI:10.1161/STROKEAHA.107.506378 |
| | N,N'-[1,2-Ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxymethyl)glycine 1,1'-bis[2-(octyloxy)ethyl] ester Preparation Products And Raw materials |
|