|
|
| | 4-phenylbutylphosphonic acid Basic information |
| Product Name: | 4-phenylbutylphosphonic acid | | Synonyms: | 4-phenylbutylphosphonic acid;Fosinopril Related Compound H (25 mg) (4-phenylbutyl phosphonic acid);Fosinopril IMpurity G;4-Phenyl butyl phosphoric acid;Fosinopril Impurity 3;Phosphonic acid, P-(4-phenylbutyl)-;Fosinopril Sodium Impurity 18;Fosinopril Related Compound H (4-phenylbutyl phosphonic acid) (1283481) | | CAS: | 46348-61-2 | | MF: | C10H15O3P | | MW: | 214.2 | | EINECS: | | | Product Categories: | | | Mol File: | 46348-61-2.mol |  |
| | 4-phenylbutylphosphonic acid Chemical Properties |
| Melting point | 93℃ (ethyl acetate hexane ) | | storage temp. | 2-8°C | | Major Application | pharmaceutical | | InChI | 1S/C10H15O3P/c11-14(12,13)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H2,11,12,13) | | InChIKey | PJOFGDOSMWTOOQ-UHFFFAOYSA-N | | SMILES | [P](=O)(O)(O)CCCCc1ccccc1 |
| WGK Germany | 3 | | HS Code | 2931909000 | | Storage Class | 11 - Combustible Solids |
| | 4-phenylbutylphosphonic acid Usage And Synthesis |
| Uses | 4-Phenylbutylphosphonic Acid is an impurity in the synthesis of Fosinopril (F727800), a phosphinic acid containing angiotensin converting enzyme (ACE) inhibitor. Antihypertensive. |
| | 4-phenylbutylphosphonic acid Preparation Products And Raw materials |
|