|
|
| | FOSINOPRILAT Basic information |
| | FOSINOPRILAT Chemical Properties |
| Melting point | >3000C | | alpha | D -24° (c = 1 in methanol) | | Boiling point | 728.9±60.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 2.75±0.50(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChIKey | WOIWWYDXDVSWAZ-RTWAWAEBSA-N | | SMILES | [P](=O)(O)(CCCCc3ccccc3)CC(=O)N1[C@@H](C[C@H](C1)C2CCCCC2)C(=O)O |
| WGK Germany | 3 | | HS Code | 2933995300 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1A |
| | FOSINOPRILAT Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A metabolite of Fosinopril, a phosphinic acid containing angiotensin converting enzyme (ACE) inhibitor | | Uses | Fosinoprilat (Fosinopril EP Impurity A) is a metabolite of Fosinopril (F727800), a phosphinic acid containing angiotensin converting enzyme (ACE) inhibitor. | | Definition | ChEBI: A phosphinic acid-containing N-acyl derivative of (4S)-cyclohexyl-L-proline. An inhibitor of angiotensin converting enzyme (ACE), it is used as the phosphinate ester pro-drug fosinopril for treatment of
ypertension and chronic heart failure. | | in vivo | Fosfenopril (0.5 mg/kg bolus plus 0.1 mg/kg/min, IV, once) increases p-aminohippurate (PAH) clearance and glomerular filtration rate (GFR) in dogs[3]. | Animal Model: | Famale mongrel dogs (n=7)[3] | | Dosage: | 0.5 mg/kg (1.1 mumol/kg) bolus plus 0.1 mg/kg/min (0.22 mumol/kg/min) | | Administration: | IV, once | | Result: | Increased p-aminohippurate (PAH) clearance and glomerular filtration rate (GFR) by 25 and 16%, respectively without changing arterial pressure (AP). |
| | IC 50 | TLR4; NF-κB; IL-6; IL-1β |
| | FOSINOPRILAT Preparation Products And Raw materials |
|