| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-(3-Aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)benzamidehydrochloride Basic information |
| Product Name: | N-(3-Aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)benzamidehydrochloride | | Synonyms: | AMTB hydrate;N-(3-aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)-benzamide hydrochloride (1:1) hyclate;AMTB hydrochloride;N-(3-Aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)benzamidehydrochloride;AMTB NEW;AMTB HCl;voltage,channel,TRP Channel,inhibit,painful,breast,cancer,bladder,Inhibitor,sodium,AMTB hydrochloride,NaV,TRPM8,overactive,Transient receptor potential channels,gated,syndrome,cells;AMTB hydrochloride, 10 mM in DMSO | | CAS: | 926023-82-7 | | MF: | C23H26N2O2S.HCl | | MW: | 431 | | EINECS: | | | Product Categories: | | | Mol File: | 926023-82-7.mol | ![N-(3-Aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)benzamidehydrochloride Structure](CAS/GIF/926023-82-7.gif) |
| | N-(3-Aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)benzamidehydrochloride Chemical Properties |
| storage temp. | Desiccate at +4°C | | solubility | DMSO: ≥10mg/mL | | form | powder | | color | white to tan | | InChI | InChI=1S/C23H26N2O2S.ClH/c1-18-7-4-8-19(15-18)17-27-22-11-3-2-10-21(22)23(26)25(13-6-12-24)16-20-9-5-14-28-20;/h2-5,7-11,14-15H,6,12-13,16-17,24H2,1H3;1H | | InChIKey | UDXGBANGPYONOK-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1OCC1C=CC=C(C)C=1)(=O)N(CCCN)CC1SC=CC=1.Cl |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-(3-Aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)benzamidehydrochloride Usage And Synthesis |
| Uses | AMTB hydrate has been used as an inhibitor of transient receptor potential cation channel, subfamily melastatin, member 8 (TRPM8) in breast cancer cells and murine T cells. | | Biochem/physiol Actions | AMTB is a 2-benzyloxy-benzoic acid amide derivative, which also inhibits voltage-gated sodium channels (Nav) and their isoforms. | | storage | Room temperature (desiccate) |
| | N-(3-Aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(2-thienylmethyl)benzamidehydrochloride Preparation Products And Raw materials |
|