| Company Name: |
GLP Pharma Standards
|
| Tel: |
+91 9866074638 |
| Email: |
info@glppharmastandards.com |
| Products Intro: |
Product Name:Acebutolol EP Impurity I/Acebutolol USP Related Compound I CAS:441019-91-6 Purity:NLT 95% Package:25 MG 50 MG 100 MG 250 MG EXTRA
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:rac N-Desisopropyl-N-ethyl Acebutolol CAS:441019-91-6 Package:100Mg,10Mg
|
| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:rac N-Desisopropyl-N-ethyl Acebutolol
;N-[3-Acetyl-4-[3-(ethylaMino)-2-hydroxypropoxy]phenyl]butanaMide; N-[3-Acetyl-4-[(2RS)-3-(ethylaMino)-2-hydroxypropoxy]phenyl]butanaMide; CAS:441019-91-6 Purity:98+% Package:1Mg;5Mg;10Mg;50Mg;100Mg;500Mg
|
|
| | rac N-Desisopropyl-N-ethyl Acebutolol Basic information |
| | rac N-Desisopropyl-N-ethyl Acebutolol Chemical Properties |
| Boiling point | 562.3±50.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.13±0.70(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H26N2O4/c1-4-6-17(22)19-13-7-8-16(15(9-13)12(3)20)23-11-14(21)10-18-5-2/h7-9,14,18,21H,4-6,10-11H2,1-3H3,(H,19,22) | | InChIKey | BKGQPZMMLAGZCQ-UHFFFAOYSA-N | | SMILES | N(CC(O)COc1c(cc(cc1)NC(=O)CCC)C(=O)C)CC |
| WGK Germany | WGK 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids |
| | rac N-Desisopropyl-N-ethyl Acebutolol Usage And Synthesis |
| Uses | Acebutolol (A123800) impurity. Acebutolol EP Impurity I |
| | rac N-Desisopropyl-N-ethyl Acebutolol Preparation Products And Raw materials |
|